CDK7-IN-25 structure
|
Common Name | CDK7-IN-25 | ||
|---|---|---|---|---|
| CAS Number | 2009209-60-1 | Molecular Weight | 560.65 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C33H32N6O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CDK7-IN-25CDK7-IN-25 (CY-16-1) is a CDK-7 inhibitor (IC50<1nM) that can be used in cancer research[1]. |
| Name | CDK7-IN-25 |
|---|
| Description | CDK7-IN-25 (CY-16-1) is a CDK-7 inhibitor (IC50<1nM) that can be used in cancer research[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: <1nM (CDK-7)[1]. |
| References |
[1]. Yi Chen, et al. Covalent inhibitors of cdk-7. Patent US20180008604A1. |
| Molecular Formula | C33H32N6O3 |
|---|---|
| Molecular Weight | 560.65 |
| InChIKey | PVRJKFUTSFKLDZ-PLNGDYQASA-N |
| SMILES | C=CC(=O)Nc1ccc(C(=O)Nc2cc3cc(c2)Nc2nccc(n2)-c2cccc(c2)OCCC=CCN(C)C3)cc1 |