N3-L-Dab(Boc)-OH structure
|
Common Name | N3-L-Dab(Boc)-OH | ||
|---|---|---|---|---|
| CAS Number | 1932403-71-8 | Molecular Weight | 244.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H16N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of N3-L-Dab(Boc)-OHN3-L-Dab(Boc)-OH is a click chemistry reagent containing an azide group. N3-L-Dab(Boc)-OH can be used for the research of various biochemical[1]. |
| Name | N3-L-Dab(Boc)-OH |
|---|
| Description | N3-L-Dab(Boc)-OH is a click chemistry reagent containing an azide group. N3-L-Dab(Boc)-OH can be used for the research of various biochemical[1]. |
|---|---|
| Related Catalog |
| Molecular Formula | C9H16N4O4 |
|---|---|
| Molecular Weight | 244.25 |
| InChIKey | JLMWKZYQNHSSAD-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)NCCC(N=[N+]=[N-])C(=O)O |