N,N'-di-4-carboethoxyanilide of malonic acid
Modify Date: 2025-09-28 15:33:09
N,N'-di-4-carboethoxyanilide of malonic acid structure
|
Common Name | N,N'-di-4-carboethoxyanilide of malonic acid | ||
|---|---|---|---|---|
| CAS Number | 19288-86-9 | Molecular Weight | 398.40900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H22N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N'-di-4-carboethoxyanilide of malonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H22N2O6 |
|---|---|
| Molecular Weight | 398.40900 |
| Exact Mass | 398.14800 |
| PSA | 110.80000 |
| LogP | 3.15330 |
| InChIKey | BWCPUAMNSZPNLF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(NC(=O)CC(=O)Nc2ccc(C(=O)OCC)cc2)cc1 |
| Malonsaeure-bis-(4-carbaethoxy-anilid) |
| N,N'-bis(p-ethoxycarbonylphenyl)malonamide |
| Malonsaeure-bis-<4-carbaethoxy-anilid> |
| N.N'-Malonyl-bis-<4-amino-benzoesaeure-aethylester> |