NF-κB-IN-3 structure
|
Common Name | NF-κB-IN-3 | ||
|---|---|---|---|---|
| CAS Number | 1873311-82-0 | Molecular Weight | 458.86 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H18ClF3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of NF-κB-IN-3NF-κB-IN-3 (Compound 2) is a NF-κB inhibitor with an IC50 of 0.70 µM. NF-κB-IN-3 can be used as an antitumor agent[1]. |
| Name | NF-κB-IN-3 |
|---|
| Description | NF-κB-IN-3 (Compound 2) is a NF-κB inhibitor with an IC50 of 0.70 µM. NF-κB-IN-3 can be used as an antitumor agent[1]. |
|---|---|
| Related Catalog | |
| Target |
NF-κB:0.70 μM (IC50) |
| References |
| Molecular Formula | C24H18ClF3N2O2 |
|---|---|
| Molecular Weight | 458.86 |
| InChIKey | AQAHZVKARZMSBW-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1C(F)(F)F)C1CCc2ccccc2N1C(=O)c1cccc(Cl)c1 |