trioctyl phosphate structure
|
Common Name | trioctyl phosphate | ||
|---|---|---|---|---|
| CAS Number | 1806-54-8 | Molecular Weight | 434.63300 | |
| Density | 0.928g/cm3 | Boiling Point | 414.6ºC at 760mmHg | |
| Molecular Formula | C24H51O4P | Melting Point | -74ºC | |
| MSDS | N/A | Flash Point | 218ºC | |
| Name | trioctyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.928g/cm3 |
|---|---|
| Boiling Point | 414.6ºC at 760mmHg |
| Melting Point | -74ºC |
| Molecular Formula | C24H51O4P |
| Molecular Weight | 434.63300 |
| Flash Point | 218ºC |
| Exact Mass | 434.35200 |
| PSA | 54.57000 |
| LogP | 9.22580 |
| Vapour Pressure | 1.06E-06mmHg at 25°C |
| Index of Refraction | 1.448 |
| InChIKey | WVPGXJOLGGFBCR-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOP(=O)(OCCCCCCCC)OCCCCCCCC |
| HS Code | 2919900090 |
|---|
|
~%
trioctyl phosphate CAS#:1806-54-8 |
| Literature: Dorfman; Polimbetova; Aibasov Russian Journal of General Chemistry, 1996 , vol. 66, # 2 p. 231 - 247 |
|
~%
trioctyl phosphate CAS#:1806-54-8 |
| Literature: Dorfman, Ya. A.; Polimbetova, G. S.; Aibasov, E. Zh.; Borangazieva, A. K.; Kokpanbaeva, A. O.; Faizova, F. Kh. J. Gen. Chem. USSR (Engl. Transl.), 1992 , vol. 62, # 10.1 p. 2256 - 2261,1860 - 1864 |
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| EINECS 217-305-1 |
| Phosphorsaeure-trioctylester |
| trioctylphosphine oxide |
| phosphoric acid trioctyl ester |
| Tri-N-octyl phosphate |
| n-octyl phosphate |