1,1,1,3,3,3-hexafluoro-N-(1,1,1,3,3,3-hexafluoropropan-2-ylideneamino)propan-2-imine structure
|
Common Name | 1,1,1,3,3,3-hexafluoro-N-(1,1,1,3,3,3-hexafluoropropan-2-ylideneamino)propan-2-imine | ||
|---|---|---|---|---|
| CAS Number | 1619-84-7 | Molecular Weight | 328.05800 | |
| Density | 1.439 g/mL at 25ºC(lit.) | Boiling Point | 67-68ºC(lit.) | |
| Molecular Formula | C6F12N2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1,1,1,3,3,3-hexafluoro-N-(1,1,1,3,3,3-hexafluoropropan-2-ylideneamino)propan-2-imine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.439 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 67-68ºC(lit.) |
| Molecular Formula | C6F12N2 |
| Molecular Weight | 328.05800 |
| Flash Point | >230 °F |
| Exact Mass | 327.98700 |
| PSA | 24.72000 |
| LogP | 4.03260 |
| Vapour Pressure | 759mmHg at 25°C |
| Index of Refraction | n20/D 1.3(lit.) |
| InChIKey | SZLJMGDRBNZIIE-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(=NN=C(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2928000090 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Hexafluoraceton-azin |
| 1,1,1,3,3,3-hexafluoro-propan-2-one azine |
| MFCD00067583 |
| Hexafluoroaceton-azin |
| hexafluoroacetone azine |
| bis-(2,2,2-trifluoro-1-trifluoromethyl-ethylidene)-hydrazine |