3-Phenyl-2,4(1H,3H)-quinazolinedithione structure
|
Common Name | 3-Phenyl-2,4(1H,3H)-quinazolinedithione | ||
|---|---|---|---|---|
| CAS Number | 16081-93-9 | Molecular Weight | 270.373 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 420.4±28.0 °C at 760 mmHg | |
| Molecular Formula | C14H10N2S2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 208.1±24.0 °C | |
| Name | 3-Phenyl-2,4(1H,3H)-quinazolinedithione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 420.4±28.0 °C at 760 mmHg |
| Molecular Formula | C14H10N2S2 |
| Molecular Weight | 270.373 |
| Flash Point | 208.1±24.0 °C |
| Exact Mass | 270.028534 |
| LogP | 3.30 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.797 |
| InChIKey | DJJOAJCVIYRELX-UHFFFAOYSA-N |
| SMILES | S=c1[nH]c2ccccc2c(=S)n1-c1ccccc1 |
| Hazard Statements | H413 |
|---|---|
| RIDADR | NONH for all modes of transport |
| 3-Phenyl-2,4(1H,3H)-quinazolinedithione |
| 2,4(1H,3H)-Quinazolinedithione, 3-phenyl- |