1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propane structure
|
Common Name | 1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propane | ||
|---|---|---|---|---|
| CAS Number | 16005-38-2 | Molecular Weight | 411.94000 | |
| Density | 2.097g/cm3 | Boiling Point | 88ºC | |
| Molecular Formula | C5F11IO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 26.7ºC | |
| Name | 1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propane |
|---|---|
| Synonym | More Synonyms |
| Density | 2.097g/cm3 |
|---|---|
| Boiling Point | 88ºC |
| Molecular Formula | C5F11IO |
| Molecular Weight | 411.94000 |
| Flash Point | 26.7ºC |
| Exact Mass | 411.88200 |
| PSA | 9.23000 |
| LogP | 4.41400 |
| Vapour Pressure | 18.2mmHg at 25°C |
| Index of Refraction | 1.343 |
| InChIKey | ZTRORDXSFFFPOW-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(OC(F)(F)C(F)(F)I)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| HS Code | 2909199090 |
|
~%
1,1,1,2,3,3,3-h... CAS#:16005-38-2 |
| Literature: Evans,F.W. et al. Journal of Organic Chemistry, 1968 , vol. 33, # 5 p. 1839 - 1844 |
| HS Code | 2909199090 |
|---|---|
| Summary | 2909199090. other acyclic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 1-iodo-4-trifluoromethyl-3-oxaperfluoropentane |
| 4-trifluoromethyl-3-oxa-perfluoropentyliodide |
| Perfluorpropyl-2-iodtetrafluorethylether |
| Heptafluorisopropyl-2-iodtetrafluorethylether |
| Perfluorisopropyl-2'-jod-tetrafluoraethyl-aether |
| PC0308 |
| perfluoro-1-iodo-3-oxa-4-trifluoromethylpentane |
| 2-Iodotetrafluoroethyl heptafluoroisopropyl ether |
| 1,1,2,2-Tetrafluoro-1-iodo-2-heptafluoroisopropoxyethane |