1-(dimethoxyphosphorylmethyl)-3-nitrobenzene structure
|
Common Name | 1-(dimethoxyphosphorylmethyl)-3-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 152528-25-1 | Molecular Weight | 245.16900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H12NO5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(dimethoxyphosphorylmethyl)-3-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H12NO5P |
|---|---|
| Molecular Weight | 245.16900 |
| Exact Mass | 245.04500 |
| PSA | 91.16000 |
| LogP | 3.10390 |
| InChIKey | JEUMBXRAOMQFLM-UHFFFAOYSA-N |
| SMILES | COP(=O)(Cc1cccc([N+](=O)[O-])c1)OC |
|
~98%
1-(dimethoxypho... CAS#:152528-25-1 |
| Literature: Witt, Dariusz; Rachon, Janusz Phosphorus, Sulfur and Silicon and the Related Elements, 1995 , vol. 107, # 1-4 p. 33 - 48 |
|
~%
1-(dimethoxypho... CAS#:152528-25-1 |
| Literature: Watanabe; Ikishima; Matsuo; Yoshida Journal of the American Chemical Society, 2001 , vol. 123, # 34 p. 8402 - 8403 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Phosphonic acid,[(3-nitrophenyl)methyl]-,dimethyl ester |
| dimethyl (3-nitrophenyl)methyl phosphonate |
| (3-nitro-benzyl)-phosphonic acid dimethyl ester |