1,3-dimethyl-6,7-dinitroperimidin-2-one
Modify Date: 2025-09-23 20:02:04
1,3-dimethyl-6,7-dinitroperimidin-2-one structure
|
Common Name | 1,3-dimethyl-6,7-dinitroperimidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 134180-25-9 | Molecular Weight | 302.24200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3-dimethyl-6,7-dinitroperimidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H10N4O5 |
|---|---|
| Molecular Weight | 302.24200 |
| Exact Mass | 302.06500 |
| PSA | 118.57000 |
| LogP | 2.89300 |
| InChIKey | GXGCNAFVCOACRX-UHFFFAOYSA-N |
| SMILES | CN1C(=O)N(C)c2ccc([N+](=O)[O-])c3c([N+](=O)[O-])ccc1c23 |
|
~33%
1,3-dimethyl-6,... CAS#:134180-25-9 |
| Literature: Barth, Thomas; Neugebauer, Franz A. Journal of Organic Chemistry, 1995 , vol. 60, # 17 p. 5401 - 5406 |
|
~54%
1,3-dimethyl-6,... CAS#:134180-25-9 |
| Literature: Sorokin; Ozeryanskii; Pozharskii Russian Journal of Organic Chemistry, 2002 , vol. 38, # 5 p. 699 - 708 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,3-dimethyl-6,7-dinitro-1H-perimiden-2-one |
| 1,3-dimethyl-6,7-dinitroperimidin-2(1H)-one |
| 1H-Perimidin-2(3H)-one,1,3-dimethyl-6,7-dinitro |
| 1,3-Dimethyl-6,7-dinitro-1H-perimidin-2(3H)-one |