1,3-dimethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2,4-dione structure
|
Common Name | 1,3-dimethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 49786-32-5 | Molecular Weight | 180.20400 | |
| Density | 1.28g/cm3 | Boiling Point | 288.8ºC at 760 mmHg | |
| Molecular Formula | C9H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.1ºC | |
| Name | 1,3-dimethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 288.8ºC at 760 mmHg |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.20400 |
| Flash Point | 126.1ºC |
| Exact Mass | 180.09000 |
| PSA | 44.00000 |
| Index of Refraction | 1.584 |
| InChIKey | BDLFOWSQKJPVEK-UHFFFAOYSA-N |
| SMILES | Cn1c2c(c(=O)n(C)c1=O)CCC2 |
|
~%
1,3-dimethyl-6,... CAS#:49786-32-5 |
| Literature: deStevens et al. Archives of Biochemistry, 1959 , vol. 83, p. 141,148 |
|
~%
1,3-dimethyl-6,... CAS#:49786-32-5 |
| Literature: deStevens et al. Archives of Biochemistry, 1959 , vol. 83, p. 141,148 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,3-dimethyl-5,6-trimethyleneuracil |
| 1,3-Dimethyl-1,5,6,7-tetrahydro-cyclopentapyrimidin-2,4-dion |
| 1,3-dimethyl-1,5,6,7-tetrahydro-cyclopentapyrimidine-2,4-dione |
| 5,6-trimethylene-1,3-dimethyluracil |