1-methyl-5-phenylmethoxyindole-2-carboxylic acid structure
|
Common Name | 1-methyl-5-phenylmethoxyindole-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 133845-42-8 | Molecular Weight | 281.30600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methyl-5-phenylmethoxyindole-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H15NO3 |
|---|---|
| Molecular Weight | 281.30600 |
| Exact Mass | 281.10500 |
| PSA | 51.46000 |
| LogP | 3.45550 |
| InChIKey | UPJCRKMBZZSXEY-UHFFFAOYSA-N |
| SMILES | Cn1c(C(=O)O)cc2cc(OCc3ccccc3)ccc21 |
|
~%
1-methyl-5-phen... CAS#:133845-42-8 |
| Literature: BANYU PHARMACEUTICAL CO., LTD. Patent: EP1798221 A1, 2007 ; Location in patent: Page/Page column 24-25 ; |
|
~92%
1-methyl-5-phen... CAS#:133845-42-8 |
| Literature: Cruces, MA; Elorriaga, C; Fernandez-Alvarez, E European Journal of Medicinal Chemistry, 1991 , vol. 26, # 1 p. 33 - 41 |
|
~%
1-methyl-5-phen... CAS#:133845-42-8 |
| Literature: Cruces, MA; Elorriaga, C; Fernandez-Alvarez, E European Journal of Medicinal Chemistry, 1991 , vol. 26, # 1 p. 33 - 41 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 5-Benzyloxy-1-methylindole-2-carboxylic acid |
| 1H-Indole-2-carboxylic acid,1-methyl-5-(phenylmethoxy) |
| 5-(benzyloxy)-1-methyl-1H-indole-2-carboxylic acid |
| 2-(5-benzyloxy-1-methylindole)carboxylic acid |