Omeprazole metabolite Omeprazole sulfone-13C,d3 structure
|
Common Name | Omeprazole metabolite Omeprazole sulfone-13C,d3 | ||
|---|---|---|---|---|
| CAS Number | 1261393-28-5 | Molecular Weight | 365.43 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C1613CH16D3N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Omeprazole metabolite Omeprazole sulfone-13C,d3Omeprazole metabolite Omeprazole sulfone-13C,d3 is the deuterium and 13C labeled Omeprazole metabolite Omeprazole sulfone[1]. |
| Name | Omeprazole metabolite Omeprazole sulfone-13C,d3 |
|---|
| Description | Omeprazole metabolite Omeprazole sulfone-13C,d3 is the deuterium and 13C labeled Omeprazole metabolite Omeprazole sulfone[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C1613CH16D3N3O4S |
|---|---|
| Molecular Weight | 365.43 |
| InChIKey | IXEQEYRTSRFZEO-LBDFIVMYSA-N |
| SMILES | COc1ccc2nc(S(=O)(=O)Cc3ncc(C)c(OC)c3C)[nH]c2c1 |