N-[4-[bis(2-chloroethyl)amino]phenyl]acetamide structure
|
Common Name | N-[4-[bis(2-chloroethyl)amino]phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 1215-16-3 | Molecular Weight | 275.17400 | |
| Density | 1.272g/cm3 | Boiling Point | 469.5ºC at 760mmHg | |
| Molecular Formula | C12H16Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.8ºC | |
| Name | N-[4-[bis(2-chloroethyl)amino]phenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.272g/cm3 |
|---|---|
| Boiling Point | 469.5ºC at 760mmHg |
| Molecular Formula | C12H16Cl2N2O |
| Molecular Weight | 275.17400 |
| Flash Point | 237.8ºC |
| Exact Mass | 274.06400 |
| PSA | 35.83000 |
| LogP | 3.57850 |
| Vapour Pressure | 5.47E-09mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | KKJPUHZODXVLPP-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(N(CCCl)CCCl)cc1 |
|
~%
N-[4-[bis(2-chl... CAS#:1215-16-3 |
| Literature: Szekerke,M. et al. Journal of the Chemical Society, 1965 , p. 1907 - 1912 |
|
~%
N-[4-[bis(2-chl... CAS#:1215-16-3 |
| Literature: Everett; Ross Journal of the Chemical Society, 1949 , p. 1972,1974 |
|
~%
N-[4-[bis(2-chl... CAS#:1215-16-3 |
| Literature: Everett; Ross Journal of the Chemical Society, 1949 , p. 1972,1974 |
|
~%
N-[4-[bis(2-chl... CAS#:1215-16-3 |
| Literature: Szekerke,M. et al. Journal of the Chemical Society, 1965 , p. 1907 - 1912 |
| Acetyl-N-(p-aminophenyl)-nitrogen mustard |
| p-(Bis-2-chlorethylamino)acetanilid |
| 4'-(Bis(2-chloroethyl)amino)acetanilide |
| acetic acid-{4-[bis-(2-chloro-ethyl)-amino]-anilide} |
| N-(p-Acetyl-amino-phenyl)-2,2'-dichlorodiethylamine |
| Essigsaeure-{4-[bis-(2-chlor-aethyl)-amino]-anilid} |
| N'.N'-Bis-(2-chlor-aethyl)-N-acetyl-p-phenylendiamin |
| N,N-Bis-(2-chlor-aethyl)-4-acetamino-anilin |
| N-(4-(Bis(2-chloroethyl)amino)phenyl)acetamide |
| ACETANILIDE,4'-(BIS(2-CHLOROETHYL)AMINO) |
| Lonin 3 |
| N-Acetyl-N',N'-bis-(2-chlor-aethyl)-p-phenylendiamin |
| p-Acetylaminophenyl derivative of nitrogen mustard |