DEA α-CHCA structure
|
Common Name | DEA α-CHCA | ||
|---|---|---|---|---|
| CAS Number | 1194607-09-4 | Molecular Weight | 318.41100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H26N2O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | α-Cyano-4-hydroxycinnamic acid N-ethyl-N,N-diisopropylammonium salt |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H26N2O3 |
|---|---|
| Molecular Weight | 318.41100 |
| Exact Mass | 318.19400 |
| PSA | 84.56000 |
| LogP | 3.50888 |
| InChIKey | VBOPFUGDNCRKIQ-HGKIGUAWSA-N |
| SMILES | CCN(C(C)C)C(C)C.N#CC(=Cc1ccc(O)cc1)C(=O)O |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 + H312 + H332-H315-H319-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Hazard Codes | Xn |
| Risk Phrases | 20/21/22-36/37/38 |
| Safety Phrases | 26-36/37 |
| RIDADR | NONH for all modes of transport |
|
Towards a Second Generation of Ionic Liquid Matrices (ILMs) for MALDI-MS of Peptides, Proteins, and Carbohydrates
J. Am. Soc. Mass Spectrom. 20 , 1790-1800, (2009) Second generation ionic liquid matrices are developed, examined, and tested. They have shown a wide mass detection range (<1000 Da to >270,000 Da) for proteins and peptides with greater S/N ratios tha... |
|
|
A second-generation ionic liquid matrix-assisted laser desorption/ionization matrix for effective mass spectrometric analysis of biodegradable polymers.
Rapid Commun. Mass Spectrom. 23 , 3409-3422, (2009) A second generation ionic liquid matrix (ILM), N,N-diisopropylethylammonium alpha-cyano-4-hydroxycinnamate (DEA-CHCA), was developed for the characterization of polar biodegradable polymers. It is com... |
|
|
Advances in analytical chemistry using the unique properties of ionic liquids. Tan, Zhi-qiang, Jing-fu Liu, and Long Pang.
TrAC, Trends Anal. Chem. 39 , 218-227, (2012)
|
| (Z)-2-cyano-3-(4-hydroxyphenyl)prop-2-enoic acid,N-ethyl-N-propan-2-ylpropan-2-amine |