Z-Thioprolyl-Thioproline structure
|
Common Name | Z-Thioprolyl-Thioproline | ||
|---|---|---|---|---|
| CAS Number | 118059-40-8 | Molecular Weight | 382.45 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18N2O5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Z-Thioprolyl-ThioprolineZ-Thioprolyl-Thioproline is a bovine brain prolyl endopeptidase (PEP) inhibitor (IC50=16 µM; Ki=37 µM). Z-Thioprolyl-Thioproline is used in the study of neurological disorders such as memory disorders and cognitive disorders[1]. |
| Name | Z-Thioprolyl-Thioproline |
|---|
| Description | Z-Thioprolyl-Thioproline is a bovine brain prolyl endopeptidase (PEP) inhibitor (IC50=16 µM; Ki=37 µM). Z-Thioprolyl-Thioproline is used in the study of neurological disorders such as memory disorders and cognitive disorders[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 16 µM (PEP)[1]. |
| Molecular Formula | C16H18N2O5S2 |
|---|---|
| Molecular Weight | 382.45 |
| InChIKey | VZHIIUWUDCHXOQ-STQMWFEESA-N |
| SMILES | O=C(O)C1CSCN1C(=O)C1CSCN1C(=O)OCc1ccccc1 |