4-naphthalen-1-yl-4-oxobut-2-enoic acid structure
|
Common Name | 4-naphthalen-1-yl-4-oxobut-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 113816-26-5 | Molecular Weight | 226.22700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-naphthalen-1-yl-4-oxobut-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H10O3 |
|---|---|
| Molecular Weight | 226.22700 |
| Exact Mass | 226.06300 |
| PSA | 54.37000 |
| LogP | 2.66330 |
| InChIKey | PFTQWZDYAKHSDM-UHFFFAOYSA-N |
| SMILES | O=C(O)C=CC(=O)c1cccc2ccccc12 |
|
~%
4-naphthalen-1-... CAS#:113816-26-5 |
| Literature: Steinbach; Becker Journal of the American Chemical Society, 1954 , vol. 76, p. 5808 |
|
~24%
4-naphthalen-1-... CAS#:113816-26-5 |
| Literature: Kameo; Asami; Ogawa; Matsunaga; Saito; Tomisawa; Sota Chemical and Pharmaceutical Bulletin, 1989 , vol. 37, # 5 p. 1260 - 1267 |
|
~%
4-naphthalen-1-... CAS#:113816-26-5 |
| Literature: Martin; Stoffyn Bulletin des Societes Chimiques Belges, 1950 , vol. 59, p. 83,87 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-Butenoic acid,4-(1-naphthalenyl)-4-oxo-,(E) |
| 2-Butenoic acid,4-(1-naphthalenyl)-4-oxo |
| 3-(1-naphthoyl)acrylic acid |