(2,5-dioxopyrrolidin-1-yl) 1,2,2,2-tetrachloroethyl carbonate structure
|
Common Name | (2,5-dioxopyrrolidin-1-yl) 1,2,2,2-tetrachloroethyl carbonate | ||
|---|---|---|---|---|
| CAS Number | 107960-02-1 | Molecular Weight | 324.93000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H5Cl4NO5 | Melting Point | 110ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2,5-dioxopyrrolidin-1-yl) 1,2,2,2-tetrachloroethyl carbonate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 110ºC |
|---|---|
| Molecular Formula | C7H5Cl4NO5 |
| Molecular Weight | 324.93000 |
| Exact Mass | 322.89200 |
| PSA | 72.91000 |
| LogP | 2.07660 |
| Index of Refraction | 1.561 |
| InChIKey | NZLNRXJWZWZVSG-UHFFFAOYSA-N |
| SMILES | O=C(OC(Cl)C(Cl)(Cl)Cl)ON1C(=O)CCC1=O |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2925190090 |
|
~81%
(2,5-dioxopyrro... CAS#:107960-02-1 |
| Literature: Jaoudai, Mahmoud; Martinez, Jean; Castro, Bertrand Journal of Organic Chemistry, 1987 , vol. 52, # 12 p. 2364 - 2367 |
|
~40%
(2,5-dioxopyrro... CAS#:107960-02-1 |
| Literature: Senet, Jean-Pierre; Sennyey, Gerard; Wooden, Gary P. Synthesis, 1988 , # 5 p. 407 - 410 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| N-succinimidyl 1,2,2,2-tetrachloroethyl carbonate |