1-ethyl-2,4,4-tris(trifluoromethyl)quinazoline structure
|
Common Name | 1-ethyl-2,4,4-tris(trifluoromethyl)quinazoline | ||
|---|---|---|---|---|
| CAS Number | 106119-57-7 | Molecular Weight | 364.21000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9F9N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-ethyl-2,4,4-tris(trifluoromethyl)quinazoline |
|---|
| Molecular Formula | C13H9F9N2 |
|---|---|
| Molecular Weight | 364.21000 |
| Exact Mass | 364.06200 |
| PSA | 15.60000 |
| LogP | 4.30780 |
| InChIKey | PPTGZKZBLSXPHM-UHFFFAOYSA-N |
| SMILES | CCN1C(C(F)(F)F)=NC(C(F)(F)F)(C(F)(F)F)c2ccccc21 |
|
~86%
1-ethyl-2,4,4-t... CAS#:106119-57-7 |
| Literature: Chkanikov, N. D.; Vershinin, V. L.; Kolomiets, A. F.; Fokin, A. V. Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), 1986 , vol. 35, # 4 p. 869 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1986 , # 4 p. 952 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |