2,6-diphenylpyran-4-thione structure
|
Common Name | 2,6-diphenylpyran-4-thione | ||
|---|---|---|---|---|
| CAS Number | 1029-95-4 | Molecular Weight | 264.34200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H12OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6-diphenylpyran-4-thione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H12OS |
|---|---|
| Molecular Weight | 264.34200 |
| Exact Mass | 264.06100 |
| PSA | 45.23000 |
| LogP | 5.34310 |
| InChIKey | OKTBDSGUQCPPJU-UHFFFAOYSA-N |
| SMILES | S=c1cc(-c2ccccc2)oc(-c2ccccc2)c1 |
| HS Code | 2932999099 |
|---|
|
~%
2,6-diphenylpyr... CAS#:1029-95-4 |
| Literature: Ho, Tse-Lok; Chein, Rong-Jie Journal of the Chinese Chemical Society, 2005 , vol. 52, # 6 p. 1223 - 1225 |
|
~%
2,6-diphenylpyr... CAS#:1029-95-4 |
| Literature: Ho, Tse-Lok; Chein, Rong-Jie Journal of the Chinese Chemical Society, 2005 , vol. 52, # 6 p. 1223 - 1225 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,6-Diphenyl-pyran-4-thione |
| 2,6-Diphenyl-4H-pyran-4-thion |
| 2,6-Diphenylpyran-4-thion |
| diphenyl-2,6 pyrannethione |
| 2,6-diphenyl-4H-pyran-4-thione |
| OKTBDSGUQCPPJU-UHFFFAOYSA |