2,6-Diphenyl-4H-pyran-4-one structure
|
Common Name | 2,6-Diphenyl-4H-pyran-4-one | ||
|---|---|---|---|---|
| CAS Number | 1029-94-3 | Molecular Weight | 248.27600 | |
| Density | 1.211g/cm3 | Boiling Point | 471.2ºC at 760 mmHg | |
| Molecular Formula | C17H12O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.8ºC | |
| Name | 2,6-diphenylpyran-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.211g/cm3 |
|---|---|
| Boiling Point | 471.2ºC at 760 mmHg |
| Molecular Formula | C17H12O2 |
| Molecular Weight | 248.27600 |
| Flash Point | 227.8ºC |
| Exact Mass | 248.08400 |
| PSA | 30.21000 |
| LogP | 3.97380 |
| Vapour Pressure | 4.75E-09mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | UWCKXOXEYVSRSD-UHFFFAOYSA-N |
| SMILES | O=c1cc(-c2ccccc2)oc(-c2ccccc2)c1 |
| Storage condition | 2-8℃ |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,6-diphenyl-pyran-4-one |
| 4H-Pyran-4-one,6-diphenyl |
| 2,6-Diphenyl-4H-pyran-4-one |