3-(4-ethoxyphenyl)-1-methyl-1-phenylurea
Modify Date: 2025-11-27 13:18:30
3-(4-ethoxyphenyl)-1-methyl-1-phenylurea structure
|
Common Name | 3-(4-ethoxyphenyl)-1-methyl-1-phenylurea | ||
|---|---|---|---|---|
| CAS Number | 10219-42-8 | Molecular Weight | 270.32600 | |
| Density | 1.18g/cm3 | Boiling Point | 457.5ºC at 760 mmHg | |
| Molecular Formula | C16H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.5ºC | |
| Name | 3-(4-ethoxyphenyl)-1-methyl-1-phenylurea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 457.5ºC at 760 mmHg |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.32600 |
| Flash Point | 230.5ºC |
| Exact Mass | 270.13700 |
| PSA | 41.57000 |
| LogP | 3.82660 |
| Vapour Pressure | 1.49E-08mmHg at 25°C |
| Index of Refraction | 1.626 |
| InChIKey | TYFABWNPRPQEPI-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(NC(=O)N(C)c2ccccc2)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N'-(4-Ethoxyphenyl)-N-methyl-N-phenylurea |
| Urea,N'-(4-ethoxyphenyl)-N-methyl-N-phenyl |
| Carbanilide,4'-ethoxy-N-methyl |