3-(4-chlorophenyl)-1-methyl-1-phenylurea
Modify Date: 2025-08-29 10:49:17
3-(4-chlorophenyl)-1-methyl-1-phenylurea structure
|
Common Name | 3-(4-chlorophenyl)-1-methyl-1-phenylurea | ||
|---|---|---|---|---|
| CAS Number | 52072-95-4 | Molecular Weight | 260.71900 | |
| Density | 1.301g/cm3 | Boiling Point | 438.2ºC at 760 mmHg | |
| Molecular Formula | C14H13ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.8ºC | |
| Name | 3-(4-chlorophenyl)-1-methyl-1-phenylurea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.301g/cm3 |
|---|---|
| Boiling Point | 438.2ºC at 760 mmHg |
| Molecular Formula | C14H13ClN2O |
| Molecular Weight | 260.71900 |
| Flash Point | 218.8ºC |
| Exact Mass | 260.07200 |
| PSA | 32.34000 |
| LogP | 4.08130 |
| Index of Refraction | 1.668 |
| InChIKey | GUINGYNEXZJZNT-UHFFFAOYSA-N |
| SMILES | CN(C(=O)Nc1ccc(Cl)cc1)c1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~%
3-(4-chlorophen... CAS#:52072-95-4 |
| Literature: Appel,R. et al. Chemische Berichte, 1974 , vol. 107, p. 698 - 705 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-(4-chlorophenyl)-1-methyl-1-phenylurea |