(2S,4R)-H-L-Pro(4-N3)-OH structure
|
Common Name | (2S,4R)-H-L-Pro(4-N3)-OH | ||
|---|---|---|---|---|
| CAS Number | 1019849-13-8 | Molecular Weight | 156.14 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H8N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (2S,4R)-H-L-Pro(4-N3)-OH(2S,4R)-H-L-Pro(4-N3)-OH is a click chemistry reagent containing an azide group. (2S,4R)-H-L-Pro(4-N3)-OH can be used for the research of various biochemical studies[1]. |
| Name | (2S,4R)-H-L-Pro(4-N3)-OH |
|---|
| Description | (2S,4R)-H-L-Pro(4-N3)-OH is a click chemistry reagent containing an azide group. (2S,4R)-H-L-Pro(4-N3)-OH can be used for the research of various biochemical studies[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C5H8N4O2 |
|---|---|
| Molecular Weight | 156.14 |
| InChIKey | BVURXEMVHARMIF-HJXLNUONSA-N |
| SMILES | Cl.[N-]=[N+]=NC1CNC(C(=O)O)C1 |