Polyphyllin G structure
|
Common Name | Polyphyllin G | ||
|---|---|---|---|---|
| CAS Number | 76296-75-8 | Molecular Weight | 1049.199 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C51H84O22 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Polyphyllin GPolyphyllin G is isolated from the rhizomes of Paris yunnanensis, with antimicrobial and anticancer activity. Polyphyllin G prevents the growth of both Gram-positive and Gram-negative bacteria with minimum inhibitory concentrations (MICs)[1].Polyphyllin G induces apoptosis dependent on the activations of caspase-8, -3, and -9, induces autophagy[2]. |
| Name | Polyphyllin VII |
|---|---|
| Synonym | More Synonyms |
| Description | Polyphyllin G is isolated from the rhizomes of Paris yunnanensis, with antimicrobial and anticancer activity. Polyphyllin G prevents the growth of both Gram-positive and Gram-negative bacteria with minimum inhibitory concentrations (MICs)[1].Polyphyllin G induces apoptosis dependent on the activations of caspase-8, -3, and -9, induces autophagy[2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Molecular Formula | C51H84O22 |
| Molecular Weight | 1049.199 |
| Exact Mass | 1048.545410 |
| PSA | 335.06000 |
| LogP | 3.76 |
| Index of Refraction | 1.623 |
| InChIKey | GJHYVTIBXQFLKG-ZAOCAYBASA-N |
| SMILES | COC1(CCC(C)COC2OC(CO)C(O)C(O)C2O)OC2CC3C4CC=C5CC(OC6OC(CO)C(OC7OC(CO)C(O)C7O)C(OC7OC(C)C(O)C(O)C7O)C6O)CCC5(C)C4CCC3(C)C2C1C |
| Hazard Codes | Xi |
|---|
| (3β,22S,25R)-3-{[α-L-Arabinofuranosyl-(1->4)-[6-deoxy-α-L-mannopyranosyl-(1->3)]-β-L-glucopyranosyl]oxy}-22-methoxyfurost-5-en-26-yl β-D-glucopyranoside |
| β-D-Glucopyranoside, (3β,22α,25R)-3-[[O-α-L-arabinofuranosyl-(1->4)-O-[6-deoxy-α-L-mannopyranosyl-(1->3)]-β-L-glucopyranosyl]oxy]-22-methoxyfurost-5-en-26-yl |