Hydroxyevodiamine structure
|
Common Name | Hydroxyevodiamine | ||
|---|---|---|---|---|
| CAS Number | 1238-43-3 | Molecular Weight | 319.357 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 633.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C19H17N3O2 | Melting Point | 190 °C | |
| MSDS | N/A | Flash Point | 336.9±31.5 °C | |
Use of HydroxyevodiamineHydroxyevodiamine (Rhetsinine) inhibits aldose reductase with an IC50 value of 24.1 μM[1]. |
| Name | Hydroxyevodiamine |
|---|---|
| Synonym | More Synonyms |
| Description | Hydroxyevodiamine (Rhetsinine) inhibits aldose reductase with an IC50 value of 24.1 μM[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 633.4±55.0 °C at 760 mmHg |
| Melting Point | 190 °C |
| Molecular Formula | C19H17N3O2 |
| Molecular Weight | 319.357 |
| Flash Point | 336.9±31.5 °C |
| Exact Mass | 319.132080 |
| PSA | 59.57000 |
| LogP | 0.46 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.797 |
| InChIKey | XYSMNZWLVJYABK-UHFFFAOYSA-N |
| SMILES | CN1c2ccccc2C(=O)N2CCc3c([nH]c4ccc(O)cc34)C21 |
| Storage condition | 2-8°C |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| (13bS)-10-Hydroxy-14-methyl-8,13,13b,14-tetrahydroindolo[2',3':3,4]pyrido[2,1-b]quinazolin-5(7H)-one |
| Hydroxy-evodiamin |
| 13b-Hydroxy-14-methyl-8,13,13b,14-tetrahydroindolo[2',3':3,4]pyrido[2,1-b]quinazolin-5(7H)-one |