2-Fluoro-3-nitrobenzoic acid structure
|
Common Name | 2-Fluoro-3-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 317-46-4 | Molecular Weight | 185.109 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 347.6±27.0 °C at 760 mmHg | |
| Molecular Formula | C7H4FNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.0±23.7 °C | |
| Name | 2-fluoro-3-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 347.6±27.0 °C at 760 mmHg |
| Molecular Formula | C7H4FNO4 |
| Molecular Weight | 185.109 |
| Flash Point | 164.0±23.7 °C |
| Exact Mass | 185.012436 |
| PSA | 83.12000 |
| LogP | 1.47 |
| Appearance of Characters | Solid |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | WLGUSLGYTNJJFV-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc([N+](=O)[O-])c1F |
| Water Solubility | Slightly soluble in water. |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Safety Phrases | 24/25 |
| HS Code | 2916399090 |
|
~62%
2-Fluoro-3-nitr... CAS#:317-46-4 |
| Literature: GLAXOSMITHKLINE LLC; ADAMS, Jerry, Leroy; FAITG, Thomas; KASPAREC, Jiri; PENG, Xin; RALPH, Jeffrey; RHEAULT, Tara Renae; WATERSON, Alex Gregory Patent: WO2011/59610 A1, 2011 ; Location in patent: Page/Page column 87-88 ; WO 2011/059610 A1 |
|
~%
2-Fluoro-3-nitr... CAS#:317-46-4 |
| Literature: WO2011/79133 A2, ; Page/Page column 152 ; WO 2011/079133 A2 |
|
~%
2-Fluoro-3-nitr... CAS#:317-46-4 |
| Literature: Bulletin des Societes Chimiques Belges, , vol. 39, p. 101 |
|
~%
2-Fluoro-3-nitr... CAS#:317-46-4 |
| Literature: Recueil des Travaux Chimiques des Pays-Bas, , vol. 33, p. 336 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Fluoro-3-nitrobenzoic acid |
| 2-fluoronitrobenzoic acid |
| 2-Fluor-3-nitro-benzoesaeure |
| 2-fluoro-3-nitro-benzoic acid |
| WNR BF CVQ |
| 3-Pyridinecarboxylic acid,4-aMino |
| 3-Carboxy-2-fluoronitrobenzene |
| 2-Fluoro-3-nitrobenzoic acid+B244 |