Benzo[b]thiophen-4-ylboronic acid pinacol ester
![Benzo[b]thiophen-4-ylboronic acid pinacol ester Structure](https://image.chemsrc.com/caspic/265/1000160-75-7.png)
Benzo[b]thiophen-4-ylboronic acid pinacol ester structure
|
Common Name | Benzo[b]thiophen-4-ylboronic acid pinacol ester | ||
|---|---|---|---|---|
| CAS Number | 1000160-75-7 | Molecular Weight | 260.16000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17BO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(1-benzothiophen-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H17BO2S |
|---|---|
| Molecular Weight | 260.16000 |
| Exact Mass | 260.10400 |
| PSA | 46.70000 |
| LogP | 3.20050 |
| InChIKey | KQTHIDLDBILMSE-UHFFFAOYSA-N |
| SMILES | CC1(C)OB(c2cccc3sccc23)OC1(C)C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xn |
|---|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| benzothiophene-4-boronic acid pinacol ester |
| 2-(benzo[b]thiophen-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| benzo[b]thiophen-4-ylboronic acid pinacol ester |
| c-2471 |
| 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-benzo[b]thiophene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-(1-benzothiophen-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane? |
| A: SMILES notation of 2-(1-benzothiophen-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is CC1(C)OB(c2cccc3sccc23)OC1(C)C. |
| Q: What is the English name of 2-(1-benzothiophen-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane? |
| A: The English name of 2-(1-benzothiophen-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is 2-(1-benzothiophen-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. |
| Q: What English synonyms does 2-(1-benzothiophen-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane have? |
| A: English synonyms of 2-(1-benzothiophen-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane: benzothiophene-4-boronic acid pinacol ester, 2-(benzo[b]thiophen-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, benzo[b]thiophen-4-ylboronic acid pinacol ester, c-2471, 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-benzo[b]thiophene. |
| Q: What is the InChIKey of 2-(1-benzothiophen-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane? |
| A: InChIKey of 2-(1-benzothiophen-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is KQTHIDLDBILMSE-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 2-(1-benzothiophen-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane? |
| A: Polar surface area (PSA) of 2-(1-benzothiophen-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is 46.70000. |
| Q: What is the CAS number of 2-(1-benzothiophen-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane? |
| A: CAS number of 2-(1-benzothiophen-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is 1000160-75-7. |
| Q: What is the molecular formula of 2-(1-benzothiophen-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane? |
| A: Molecular formula of 2-(1-benzothiophen-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is C14H17BO2S. |
| Q: What is the molecular weight of 2-(1-benzothiophen-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane? |
| A: Molecular weight of 2-(1-benzothiophen-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is 260.16000. |
| Q: What is the LogP of 2-(1-benzothiophen-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane? |
| A: LogP of 2-(1-benzothiophen-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is 3.20050. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |