3-(4-methoxyphenoxy)aniline
3-(4-methoxyphenoxy)aniline structure
|
Common Name | 3-(4-methoxyphenoxy)aniline | ||
|---|---|---|---|---|
| CAS Number | 105903-05-7 | Molecular Weight | 215.24800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(4-methoxyphenoxy)aniline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H13NO2 |
|---|---|
| Molecular Weight | 215.24800 |
| Exact Mass | 215.09500 |
| PSA | 44.48000 |
| LogP | 3.65090 |
| InChIKey | YWHQDIKEXSFCGJ-UHFFFAOYSA-N |
| SMILES | COc1ccc(Oc2cccc(N)c2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~74%
3-(4-methoxyphe... CAS#:105903-05-7 |
| Literature: Journal of the American Chemical Society, , vol. 131, # 47 p. 17423 - 17429 |
|
~60%
3-(4-methoxyphe... CAS#:105903-05-7 |
| Literature: Journal of the American Chemical Society, , vol. 131, # 47 p. 17423 - 17429 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 105903-05-7? |
| A: Chinese name of 105903-05-7 is 105903-05-7. |
| Q: What is the LogP of 3-(4-methoxyphenoxy)aniline? |
| A: LogP of 3-(4-methoxyphenoxy)aniline is 3.65090. |
| Q: What are the upstream materials of 3-(4-methoxyphenoxy)aniline? |
| A: Related upstream materials(CAS) of 3-(4-methoxyphenoxy)aniline: 696-62-8;591-27-5;104-92-7. |
| Q: What is the InChIKey of 3-(4-methoxyphenoxy)aniline? |
| A: InChIKey of 3-(4-methoxyphenoxy)aniline is YWHQDIKEXSFCGJ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 3-(4-methoxyphenoxy)aniline? |
| A: SMILES notation of 3-(4-methoxyphenoxy)aniline is COc1ccc(Oc2cccc(N)c2)cc1. |
| Q: What is the molecular formula of 3-(4-methoxyphenoxy)aniline? |
| A: Molecular formula of 3-(4-methoxyphenoxy)aniline is C13H13NO2. |
| Q: What is the CAS number of 3-(4-methoxyphenoxy)aniline? |
| A: CAS number of 3-(4-methoxyphenoxy)aniline is 105903-05-7. |
| Q: What is the polar surface area (PSA) of 3-(4-methoxyphenoxy)aniline? |
| A: Polar surface area (PSA) of 3-(4-methoxyphenoxy)aniline is 44.48000. |
| Q: What is the molecular weight of 3-(4-methoxyphenoxy)aniline? |
| A: Molecular weight of 3-(4-methoxyphenoxy)aniline is 215.24800. |
| Q: What is the English name of 3-(4-methoxyphenoxy)aniline? |
| A: The English name of 3-(4-methoxyphenoxy)aniline is 3-(4-methoxyphenoxy)aniline. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |