3,4-Dihydroxy-2,5-thiophenedicarboxylic acid 2,5-dimethyl ester, sodium salt
3,4-Dihydroxy-2,5-thiophenedicarboxylic acid 2,5-dimethyl ester, sodium salt structure
|
Common Name | 3,4-Dihydroxy-2,5-thiophenedicarboxylic acid 2,5-dimethyl ester, sodium salt | ||
|---|---|---|---|---|
| CAS Number | 108199-25-3 | Molecular Weight | 276.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H6Na2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 3,4-Dihydroxy-2,5-thiophenedicarboxylic acid 2,5-dimethyl ester, sodium salt (CAS number: 108199-25-3, molecular formula: C8H6Na2O6S, molecular weight: 276.18). For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,5-dicarbmethoxy-3,4-dihydroxy-thiophene disodium salt |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H6Na2O6S |
|---|---|
| Molecular Weight | 276.18 |
| Exact Mass | 275.96804764 |
| PSA | 126.96000 |
| LogP | 1.60890 |
| InChIKey | REFZTXNBCHFFTO-UHFFFAOYSA-L |
| SMILES | COC(=O)C1=C(C(=C(S1)C(=O)OC)[O-])[O-].[Na+].[Na+] |
| Storage condition | 2-8°C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:118851-98-2
CAS#:177364-96-4This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3,4-DIHYDROXY-2,5-THIOPHENEDICARBOXYLIC ACID DIMETHYL ESTER DISODIUM SALT |
| 2,5-Thiophenedicarboxylicacid,3,4-dihydroxy-,2,5-dimethylester,sodiumsalt |
| Dimethyl 3,4-dihydroxythiophene-2,5-dicarboxylate, disodium salt |
| 2,5-THIOPHENEDICARBOXYLIC ACID, 3,4-DIHYDROXY-, 2,5-DIMETHYL ESTER, SODIUM SALT |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2,5-dicarbmethoxy-3,4-dihydroxy-thiophene disodium salt? |
| A: SMILES notation of 2,5-dicarbmethoxy-3,4-dihydroxy-thiophene disodium salt is COC(=O)C1=C(C(=C(S1)C(=O)OC)[O-])[O-].[Na+].[Na+]. |
| Q: What is the CAS number of 2,5-dicarbmethoxy-3,4-dihydroxy-thiophene disodium salt? |
| A: CAS number of 2,5-dicarbmethoxy-3,4-dihydroxy-thiophene disodium salt is 108199-25-3. |
| Q: What is the LogP of 2,5-dicarbmethoxy-3,4-dihydroxy-thiophene disodium salt? |
| A: LogP of 2,5-dicarbmethoxy-3,4-dihydroxy-thiophene disodium salt is 1.60890. |
| Q: What English synonyms does 2,5-dicarbmethoxy-3,4-dihydroxy-thiophene disodium salt have? |
| A: English synonyms of 2,5-dicarbmethoxy-3,4-dihydroxy-thiophene disodium salt: 3,4-DIHYDROXY-2,5-THIOPHENEDICARBOXYLIC ACID DIMETHYL ESTER DISODIUM SALT, 2,5-Thiophenedicarboxylicacid,3,4-dihydroxy-,2,5-dimethylester,sodiumsalt, Dimethyl 3,4-dihydroxythiophene-2,5-dicarboxylate, disodium salt, 2,5-THIOPHENEDICARBOXYLIC ACID, 3,4-DIHYDROXY-, 2,5-DIMETHYL ESTER, SODIUM SALT. |
| Q: What are the storage conditions for 2,5-dicarbmethoxy-3,4-dihydroxy-thiophene disodium salt? |
| A: Storage conditions for 2,5-dicarbmethoxy-3,4-dihydroxy-thiophene disodium salt: 2-8°C. |
| Q: What is the English name of 2,5-dicarbmethoxy-3,4-dihydroxy-thiophene disodium salt? |
| A: The English name of 2,5-dicarbmethoxy-3,4-dihydroxy-thiophene disodium salt is 2,5-dicarbmethoxy-3,4-dihydroxy-thiophene disodium salt. |
| Q: What is the molecular formula of 2,5-dicarbmethoxy-3,4-dihydroxy-thiophene disodium salt? |
| A: Molecular formula of 2,5-dicarbmethoxy-3,4-dihydroxy-thiophene disodium salt is C8H6Na2O6S. |
| Q: What are the downstream products of 2,5-dicarbmethoxy-3,4-dihydroxy-thiophene disodium salt? |
| A: Related downstream products(CAS) of 2,5-dicarbmethoxy-3,4-dihydroxy-thiophene disodium salt: 118851-98-2;177364-96-4. |
| Q: What is the molecular weight of 2,5-dicarbmethoxy-3,4-dihydroxy-thiophene disodium salt? |
| A: Molecular weight of 2,5-dicarbmethoxy-3,4-dihydroxy-thiophene disodium salt is 276.18. |
| Q: What is the polar surface area (PSA) of 2,5-dicarbmethoxy-3,4-dihydroxy-thiophene disodium salt? |
| A: Polar surface area (PSA) of 2,5-dicarbmethoxy-3,4-dihydroxy-thiophene disodium salt is 126.96000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |