methyl 3,5-difluoro-4-nitrobenzoate
methyl 3,5-difluoro-4-nitrobenzoate structure
|
Common Name | methyl 3,5-difluoro-4-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 1123172-87-1 | Molecular Weight | 217.12600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H5F2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 3,5-difluoro-4-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H5F2NO4 |
|---|---|
| Molecular Weight | 217.12600 |
| Exact Mass | 217.01900 |
| PSA | 72.12000 |
| LogP | 2.18280 |
| InChIKey | XXLVODHRRUKGIV-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(F)c([N+](=O)[O-])c(F)c1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | T+ |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:1123172-89-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3,5-difluoro-4-nitro-benzoic acid methyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of methyl 3,5-difluoro-4-nitrobenzoate? |
| A: InChIKey of methyl 3,5-difluoro-4-nitrobenzoate is XXLVODHRRUKGIV-UHFFFAOYSA-N. |
| Q: What is the English name of methyl 3,5-difluoro-4-nitrobenzoate? |
| A: The English name of methyl 3,5-difluoro-4-nitrobenzoate is methyl 3,5-difluoro-4-nitrobenzoate. |
| Q: What is the molecular weight of methyl 3,5-difluoro-4-nitrobenzoate? |
| A: Molecular weight of methyl 3,5-difluoro-4-nitrobenzoate is 217.12600. |
| Q: What is the polar surface area (PSA) of methyl 3,5-difluoro-4-nitrobenzoate? |
| A: Polar surface area (PSA) of methyl 3,5-difluoro-4-nitrobenzoate is 72.12000. |
| Q: What is the LogP of methyl 3,5-difluoro-4-nitrobenzoate? |
| A: LogP of methyl 3,5-difluoro-4-nitrobenzoate is 2.18280. |
| Q: What is the molecular formula of methyl 3,5-difluoro-4-nitrobenzoate? |
| A: Molecular formula of methyl 3,5-difluoro-4-nitrobenzoate is C8H5F2NO4. |
| Q: What is the CAS number of methyl 3,5-difluoro-4-nitrobenzoate? |
| A: CAS number of methyl 3,5-difluoro-4-nitrobenzoate is 1123172-87-1. |
| Q: What English synonyms does methyl 3,5-difluoro-4-nitrobenzoate have? |
| A: English synonyms of methyl 3,5-difluoro-4-nitrobenzoate: 3,5-difluoro-4-nitro-benzoic acid methyl ester. |
| Q: What is the SMILES notation of methyl 3,5-difluoro-4-nitrobenzoate? |
| A: SMILES notation of methyl 3,5-difluoro-4-nitrobenzoate is COC(=O)c1cc(F)c([N+](=O)[O-])c(F)c1. |
| Q: What are the downstream products of methyl 3,5-difluoro-4-nitrobenzoate? |
| A: Related downstream products(CAS) of methyl 3,5-difluoro-4-nitrobenzoate: 1123172-89-3. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |