3-Ethylsulfonyl-2-Pyridinesulfonamide
3-Ethylsulfonyl-2-Pyridinesulfonamide structure
|
Common Name | 3-Ethylsulfonyl-2-Pyridinesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 117671-01-9 | Molecular Weight | 250.295 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 544.3±60.0 °C at 760 mmHg | |
| Molecular Formula | C7H10N2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283.0±32.9 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(Ethylsulfonyl)pyridine-2-sulfonamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 544.3±60.0 °C at 760 mmHg |
| Molecular Formula | C7H10N2O4S2 |
| Molecular Weight | 250.295 |
| Flash Point | 283.0±32.9 °C |
| Exact Mass | 250.008194 |
| PSA | 123.95000 |
| LogP | -0.04 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.562 |
| InChIKey | ZVAJJLYQUHJURI-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)c1cccnc1S(N)(=O)=O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xn |
|---|---|
| HS Code | 2935009090 |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-(Ethylsulfonyl)-2-pyridinesulfonamide |
| 3-(Ethylsulfonyl)pyridine-2-sulfonamide |
| T6NJ BSZW CSW2 |
| 3-ethylsulfonylpyridine-2-sulfonamide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 3-(Ethylsulfonyl)pyridine-2-sulfonamide? |
| A: SMILES notation of 3-(Ethylsulfonyl)pyridine-2-sulfonamide is CCS(=O)(=O)c1cccnc1S(N)(=O)=O. |
| Q: What is the boiling point of 3-(Ethylsulfonyl)pyridine-2-sulfonamide? |
| A: Boiling point of 3-(Ethylsulfonyl)pyridine-2-sulfonamide is 544.3±60.0 °C at 760 mmHg. |
| Q: What is the English name of 3-(Ethylsulfonyl)pyridine-2-sulfonamide? |
| A: The English name of 3-(Ethylsulfonyl)pyridine-2-sulfonamide is 3-(Ethylsulfonyl)pyridine-2-sulfonamide. |
| Q: What is the molecular weight of 3-(Ethylsulfonyl)pyridine-2-sulfonamide? |
| A: Molecular weight of 3-(Ethylsulfonyl)pyridine-2-sulfonamide is 250.295. |
| Q: What is the molecular formula of 3-(Ethylsulfonyl)pyridine-2-sulfonamide? |
| A: Molecular formula of 3-(Ethylsulfonyl)pyridine-2-sulfonamide is C7H10N2O4S2. |
| Q: What is the polar surface area (PSA) of 3-(Ethylsulfonyl)pyridine-2-sulfonamide? |
| A: Polar surface area (PSA) of 3-(Ethylsulfonyl)pyridine-2-sulfonamide is 123.95000. |
| Q: What is the InChIKey of 3-(Ethylsulfonyl)pyridine-2-sulfonamide? |
| A: InChIKey of 3-(Ethylsulfonyl)pyridine-2-sulfonamide is ZVAJJLYQUHJURI-UHFFFAOYSA-N. |
| Q: What is the LogP of 3-(Ethylsulfonyl)pyridine-2-sulfonamide? |
| A: LogP of 3-(Ethylsulfonyl)pyridine-2-sulfonamide is -0.04. |
| Q: What English synonyms does 3-(Ethylsulfonyl)pyridine-2-sulfonamide have? |
| A: English synonyms of 3-(Ethylsulfonyl)pyridine-2-sulfonamide: 3-(Ethylsulfonyl)-2-pyridinesulfonamide, 3-(Ethylsulfonyl)pyridine-2-sulfonamide, T6NJ BSZW CSW2, 3-ethylsulfonylpyridine-2-sulfonamide. |
| Q: What is the CAS number of 3-(Ethylsulfonyl)pyridine-2-sulfonamide? |
| A: CAS number of 3-(Ethylsulfonyl)pyridine-2-sulfonamide is 117671-01-9. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |