tert-Butyl 3-thioxopiperazine-1-carboxylate
tert-Butyl 3-thioxopiperazine-1-carboxylate structure
|
Common Name | tert-Butyl 3-thioxopiperazine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1182359-40-5 | Molecular Weight | 216.30100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H16N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Thioxopiperazine-1-carboxylic acid tert-butyl ester |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H16N2O2S |
|---|---|
| Molecular Weight | 216.30100 |
| Exact Mass | 216.09300 |
| PSA | 73.66000 |
| LogP | 1.42080 |
| InChIKey | NDQGYAYVFMSQSU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNC(=S)C1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
![7-tert-Butyl 3-ethyl 5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazine-3,7(8H)-dicarboxylate structure](https://image.chemsrc.com/caspic/097/1215852-11-1.png)
CAS#:1215852-11-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| MFCD19105267 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3-Thioxopiperazine-1-carboxylic acid tert-butyl ester? |
| A: InChIKey of 3-Thioxopiperazine-1-carboxylic acid tert-butyl ester is NDQGYAYVFMSQSU-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 3-Thioxopiperazine-1-carboxylic acid tert-butyl ester? |
| A: Polar surface area (PSA) of 3-Thioxopiperazine-1-carboxylic acid tert-butyl ester is 73.66000. |
| Q: What English synonyms does 3-Thioxopiperazine-1-carboxylic acid tert-butyl ester have? |
| A: English synonyms of 3-Thioxopiperazine-1-carboxylic acid tert-butyl ester: MFCD19105267. |
| Q: What is the English name of 3-Thioxopiperazine-1-carboxylic acid tert-butyl ester? |
| A: The English name of 3-Thioxopiperazine-1-carboxylic acid tert-butyl ester is 3-Thioxopiperazine-1-carboxylic acid tert-butyl ester. |
| Q: What is the LogP of 3-Thioxopiperazine-1-carboxylic acid tert-butyl ester? |
| A: LogP of 3-Thioxopiperazine-1-carboxylic acid tert-butyl ester is 1.42080. |
| Q: What are the downstream products of 3-Thioxopiperazine-1-carboxylic acid tert-butyl ester? |
| A: Related downstream products(CAS) of 3-Thioxopiperazine-1-carboxylic acid tert-butyl ester: 1215852-11-1. |
| Q: What is the SMILES notation of 3-Thioxopiperazine-1-carboxylic acid tert-butyl ester? |
| A: SMILES notation of 3-Thioxopiperazine-1-carboxylic acid tert-butyl ester is CC(C)(C)OC(=O)N1CCNC(=S)C1. |
| Q: What is the molecular weight of 3-Thioxopiperazine-1-carboxylic acid tert-butyl ester? |
| A: Molecular weight of 3-Thioxopiperazine-1-carboxylic acid tert-butyl ester is 216.30100. |
| Q: What is the molecular formula of 3-Thioxopiperazine-1-carboxylic acid tert-butyl ester? |
| A: Molecular formula of 3-Thioxopiperazine-1-carboxylic acid tert-butyl ester is C9H16N2O2S. |
| Q: What is the CAS number of 3-Thioxopiperazine-1-carboxylic acid tert-butyl ester? |
| A: CAS number of 3-Thioxopiperazine-1-carboxylic acid tert-butyl ester is 1182359-40-5. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |