tert-Butyl 3-formyl-4-hydroxybenzoate
tert-Butyl 3-formyl-4-hydroxybenzoate structure
|
Common Name | tert-Butyl 3-formyl-4-hydroxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 1224157-88-3 | Molecular Weight | 222.23700 | |
| Density | N/A | Boiling Point | 327.1±27.0°C | |
| Molecular Formula | C12H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Methyl-2-propanyl 3-formyl-4-hydroxybenzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 327.1±27.0°C |
|---|---|
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.23700 |
| Exact Mass | 222.08900 |
| PSA | 63.60000 |
| LogP | 2.16000 |
| InChIKey | LBSSNJFKFJEHIA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)c1ccc(O)c(C=O)c1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~81%
tert-Butyl 3-fo... CAS#:1224157-88-3 |
| Literature: Bereau, Virginie; Jubera, Veronique; Arnaud, Philippe; Kaiba, Abdellah; Guionneau, Philippe; Sutter, Jean-Pascal Dalton Transactions, 2010 , vol. 39, # 8 p. 2070 - 2077 |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 2-Methyl-2-propanyl 3-formyl-4-hydroxybenzoate? |
| A: LogP of 2-Methyl-2-propanyl 3-formyl-4-hydroxybenzoate is 2.16000. |
| Q: What is the molecular formula of 2-Methyl-2-propanyl 3-formyl-4-hydroxybenzoate? |
| A: Molecular formula of 2-Methyl-2-propanyl 3-formyl-4-hydroxybenzoate is C12H14O4. |
| Q: What is the molecular weight of 2-Methyl-2-propanyl 3-formyl-4-hydroxybenzoate? |
| A: Molecular weight of 2-Methyl-2-propanyl 3-formyl-4-hydroxybenzoate is 222.23700. |
| Q: What is the boiling point of 2-Methyl-2-propanyl 3-formyl-4-hydroxybenzoate? |
| A: Boiling point of 2-Methyl-2-propanyl 3-formyl-4-hydroxybenzoate is 327.1±27.0°C. |
| Q: What is the English name of 2-Methyl-2-propanyl 3-formyl-4-hydroxybenzoate? |
| A: The English name of 2-Methyl-2-propanyl 3-formyl-4-hydroxybenzoate is 2-Methyl-2-propanyl 3-formyl-4-hydroxybenzoate. |
| Q: What is the SMILES notation of 2-Methyl-2-propanyl 3-formyl-4-hydroxybenzoate? |
| A: SMILES notation of 2-Methyl-2-propanyl 3-formyl-4-hydroxybenzoate is CC(C)(C)OC(=O)c1ccc(O)c(C=O)c1. |
| Q: What is the CAS number of 2-Methyl-2-propanyl 3-formyl-4-hydroxybenzoate? |
| A: CAS number of 2-Methyl-2-propanyl 3-formyl-4-hydroxybenzoate is 1224157-88-3. |
| Q: What is the InChIKey of 2-Methyl-2-propanyl 3-formyl-4-hydroxybenzoate? |
| A: InChIKey of 2-Methyl-2-propanyl 3-formyl-4-hydroxybenzoate is LBSSNJFKFJEHIA-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 2-Methyl-2-propanyl 3-formyl-4-hydroxybenzoate? |
| A: Polar surface area (PSA) of 2-Methyl-2-propanyl 3-formyl-4-hydroxybenzoate is 63.60000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |