(1R,2R)-1,2-N,N'-bis[(methane-sulfonyl)amino]-cyclohexane
![(1R,2R)-1,2-N,N'-bis[(methane-sulfonyl)amino]-cyclohexane Structure](https://image.chemsrc.com/caspic/291/122833-58-3.png)
(1R,2R)-1,2-N,N'-bis[(methane-sulfonyl)amino]-cyclohexane structure
|
Common Name | (1R,2R)-1,2-N,N'-bis[(methane-sulfonyl)amino]-cyclohexane | ||
|---|---|---|---|---|
| CAS Number | 122833-58-3 | Molecular Weight | 270.370 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 428.5±55.0 °C at 760 mmHg | |
| Molecular Formula | C8H18N2O4S2 | Melting Point | 156-157°C | |
| MSDS | N/A | Flash Point | 212.9±31.5 °C | |
Summary: (1R,2R)-1,2-N,N'-bis[(methane-sulfonyl)amino]-cyclohexane, also known as (1R,2r)-1,2-N,N-双[(甲烷磺酰基)氨基]-环己烷, with the English name N-[(1R,2R)-2-(methanesulfonamido)cyclohexyl]methanesulfonamide, has a CAS number of 122833-58-3, a molecular formula of C8H18N2O4S2, and a molecular weight of 270.370. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[(1R,2R)-2-(methanesulfonamido)cyclohexyl]methanesulfonamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 428.5±55.0 °C at 760 mmHg |
| Melting Point | 156-157°C |
| Molecular Formula | C8H18N2O4S2 |
| Molecular Weight | 270.370 |
| Flash Point | 212.9±31.5 °C |
| Exact Mass | 270.070801 |
| PSA | 109.10000 |
| LogP | -0.70 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.536 |
| InChIKey | JUWLQVLCYRNWSV-HTQZYQBOSA-N |
| SMILES | CS(=O)(=O)NC1CCCCC1NS(C)(=O)=O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~97%
(1R,2R)-1,2-N,N... CAS#:122833-58-3 |
| Literature: Radi, Marco; Maga, Giovanni; Alongi, Maddalena; Angeli, Lucilla; Samuele, Alberta; Zanoli, Samantha; Bellucci, Luca; Tafi, Andrea; Casaluce, Gianni; Giorgi, Gianluca; Armand-Ugon, Mercedes; Gonzalez, Emmanuel; Este, Jose A.; Baltzinger, Mireille; Bec, Guillaume; Dumas, Philippe; Ennifar, Eric; Botta, Maurizio Journal of Medicinal Chemistry, 2009 , vol. 52, # 3 p. 840 - 851 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (R,R)-1,2-bis(methanesulfonylamino)cyclohexane |
| (1R,2R)-1,2-N,N'-bis[(methane-sulfonyl)amino]-cyclohexane |
| bis(methylsulfonamide) of (R,R)-1,2-cyclohexanediamine |
| N,N'-((1R,2R)-cyclohexane-1,2-diyl)dimethanesulfonamide |
| N-{(1R,2R)-2-[(methylsulfonyl)amino]cyclohexyl}methanesulfonamide |
| N,N'-(1R,2R)-1,2-Cyclohexanediyldimethanesulfonamide |
| (1R,2R)-trans-1,2-bis(methylsulfonylamino)cyclohexane |
| (R,R)-N,N'-bis(methanesulfonyl)-1,2-diaminocyclohexane |
| N-[(1R,2R)-2-methanesulfonamidocyclohexyl]methanesulfonamide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of N-[(1R,2R)-2-(methanesulfonamido)cyclohexyl]methanesulfonamide? |
| A: LogP of N-[(1R,2R)-2-(methanesulfonamido)cyclohexyl]methanesulfonamide is -0.70. |
| Q: What is the English name of N-[(1R,2R)-2-(methanesulfonamido)cyclohexyl]methanesulfonamide? |
| A: The English name of N-[(1R,2R)-2-(methanesulfonamido)cyclohexyl]methanesulfonamide is N-[(1R,2R)-2-(methanesulfonamido)cyclohexyl]methanesulfonamide. |
| Q: What is the molecular formula of N-[(1R,2R)-2-(methanesulfonamido)cyclohexyl]methanesulfonamide? |
| A: Molecular formula of N-[(1R,2R)-2-(methanesulfonamido)cyclohexyl]methanesulfonamide is C8H18N2O4S2. |
| Q: What is the InChIKey of N-[(1R,2R)-2-(methanesulfonamido)cyclohexyl]methanesulfonamide? |
| A: InChIKey of N-[(1R,2R)-2-(methanesulfonamido)cyclohexyl]methanesulfonamide is JUWLQVLCYRNWSV-HTQZYQBOSA-N. |
| Q: What is the melting point of N-[(1R,2R)-2-(methanesulfonamido)cyclohexyl]methanesulfonamide? |
| A: Melting point of N-[(1R,2R)-2-(methanesulfonamido)cyclohexyl]methanesulfonamide is 156-157°C. |
| Q: What is the boiling point of N-[(1R,2R)-2-(methanesulfonamido)cyclohexyl]methanesulfonamide? |
| A: Boiling point of N-[(1R,2R)-2-(methanesulfonamido)cyclohexyl]methanesulfonamide is 428.5±55.0 °C at 760 mmHg. |
| Q: What is the polar surface area (PSA) of N-[(1R,2R)-2-(methanesulfonamido)cyclohexyl]methanesulfonamide? |
| A: Polar surface area (PSA) of N-[(1R,2R)-2-(methanesulfonamido)cyclohexyl]methanesulfonamide is 109.10000. |
| Q: What is the CAS number of N-[(1R,2R)-2-(methanesulfonamido)cyclohexyl]methanesulfonamide? |
| A: CAS number of N-[(1R,2R)-2-(methanesulfonamido)cyclohexyl]methanesulfonamide is 122833-58-3. |
| Q: What is the SMILES notation of N-[(1R,2R)-2-(methanesulfonamido)cyclohexyl]methanesulfonamide? |
| A: SMILES notation of N-[(1R,2R)-2-(methanesulfonamido)cyclohexyl]methanesulfonamide is CS(=O)(=O)NC1CCCCC1NS(C)(=O)=O. |
| Q: What is the molecular weight of N-[(1R,2R)-2-(methanesulfonamido)cyclohexyl]methanesulfonamide? |
| A: Molecular weight of N-[(1R,2R)-2-(methanesulfonamido)cyclohexyl]methanesulfonamide is 270.370. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |