tetrahydroxy-1,4-quinone hydrate
tetrahydroxy-1,4-quinone hydrate structure
|
Common Name | tetrahydroxy-1,4-quinone hydrate | ||
|---|---|---|---|---|
| CAS Number | 123334-16-7 | Molecular Weight | 172.09200 | |
| Density | 2.609g/cm3 | Boiling Point | 370.6ºC at 760mmHg | |
| Molecular Formula | C6H4O6 | Melting Point | >300ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 192.1ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Tetrahydroxy-1,4-benzoquinone Hydrate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 2.609g/cm3 |
|---|---|
| Boiling Point | 370.6ºC at 760mmHg |
| Melting Point | >300ºC(lit.) |
| Molecular Formula | C6H4O6 |
| Molecular Weight | 172.09200 |
| Flash Point | 192.1ºC |
| Exact Mass | 172.00100 |
| PSA | 115.06000 |
| Vapour Pressure | 5.3E-07mmHg at 25°C |
| InChIKey | CJFTUKFVMMYYHH-UHFFFAOYSA-N |
| SMILES | O.O=C1C(O)=C(O)C(=O)C(O)=C1O |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,3,5,6-Tetrahydroxycyclohexa-2,5-diene-1,4-dione hydrate |
| Tetrahydroxyquinone Hydrate |
| Tetroquinone Hydrate |
| Tetrahydroxy-1,4-benzoquinone |
| MFCD00149070 |
| EINECS 206-275-5 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Tetrahydroxy-1,4-benzoquinone Hydrate? |
| A: The English name of Tetrahydroxy-1,4-benzoquinone Hydrate is Tetrahydroxy-1,4-benzoquinone Hydrate. |
| Q: What is the safety information for Tetrahydroxy-1,4-benzoquinone Hydrate? |
| A: Safety information for Tetrahydroxy-1,4-benzoquinone Hydrate: S26. |
| Q: What is the InChIKey of Tetrahydroxy-1,4-benzoquinone Hydrate? |
| A: InChIKey of Tetrahydroxy-1,4-benzoquinone Hydrate is CJFTUKFVMMYYHH-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Tetrahydroxy-1,4-benzoquinone Hydrate? |
| A: SMILES notation of Tetrahydroxy-1,4-benzoquinone Hydrate is O.O=C1C(O)=C(O)C(=O)C(O)=C1O. |
| Q: What is the boiling point of Tetrahydroxy-1,4-benzoquinone Hydrate? |
| A: Boiling point of Tetrahydroxy-1,4-benzoquinone Hydrate is 370.6ºC at 760mmHg. |
| Q: What is the molecular weight of Tetrahydroxy-1,4-benzoquinone Hydrate? |
| A: Molecular weight of Tetrahydroxy-1,4-benzoquinone Hydrate is 172.09200. |
| Q: What English synonyms does Tetrahydroxy-1,4-benzoquinone Hydrate have? |
| A: English synonyms of Tetrahydroxy-1,4-benzoquinone Hydrate: 2,3,5,6-Tetrahydroxycyclohexa-2,5-diene-1,4-dione hydrate, Tetrahydroxyquinone Hydrate, Tetroquinone Hydrate, Tetrahydroxy-1,4-benzoquinone , MFCD00149070, EINECS 206-275-5. |
| Q: What is the CAS number of Tetrahydroxy-1,4-benzoquinone Hydrate? |
| A: CAS number of Tetrahydroxy-1,4-benzoquinone Hydrate is 123334-16-7. |
| Q: What is the melting point of Tetrahydroxy-1,4-benzoquinone Hydrate? |
| A: Melting point of Tetrahydroxy-1,4-benzoquinone Hydrate is >300ºC(lit.). |
| Q: What is the polar surface area (PSA) of Tetrahydroxy-1,4-benzoquinone Hydrate? |
| A: Polar surface area (PSA) of Tetrahydroxy-1,4-benzoquinone Hydrate is 115.06000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |