4-Hydroxy-7-methyl-1,8-naphthyridine-3-carboxylic acid
4-Hydroxy-7-methyl-1,8-naphthyridine-3-carboxylic acid structure
|
Common Name | 4-Hydroxy-7-methyl-1,8-naphthyridine-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 13250-97-0 | Molecular Weight | 204.18200 | |
| Density | 1.439g/cm3 | Boiling Point | 396.2ºC at 760 mmHg | |
| Molecular Formula | C10H8N2O3 | Melting Point | 278-280 °C (decomp) | |
| MSDS | Chinese USA | Flash Point | 193.4ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Summary: 4-羟基-7-甲基-1,8-萘啶-3-羧酸 (7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid), CAS number 13250-97-0, molecular formula C10H8N2O3, molecular weight 204.18200. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.439g/cm3 |
|---|---|
| Boiling Point | 396.2ºC at 760 mmHg |
| Melting Point | 278-280 °C (decomp) |
| Molecular Formula | C10H8N2O3 |
| Molecular Weight | 204.18200 |
| Flash Point | 193.4ºC |
| Exact Mass | 204.05300 |
| PSA | 83.31000 |
| LogP | 1.34200 |
| Vapour Pressure | 5.47E-07mmHg at 25°C |
| Index of Refraction | 1.631 |
| InChIKey | WHJTTWIMQIGVJK-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(=O)c(C(=O)O)c[nH]c2n1 |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37 |
| RIDADR | NONH for all modes of transport |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4-Hydroxy-7-met... CAS#:13250-97-0 |
| Literature: Barlin, Gordon B.; Tan, Weng-Lai Australian Journal of Chemistry, 1984 , vol. 37, # 5 p. 1065 - 1073 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 7-methyl-4-hydroxy-1,8-naphthyridine-3-carboxylic acid |
| 7-methyl-4H-tetrazolo[1,5-a]quinazolin-5-one |
| 5-Hydroxy-2-methyl-1,8-naphthyridin-6-carbonsaeure |
| 6-methyltetrazolo<1,5-a>quinazolin-5(4H)-one |
| 4-hydroxy-7-methyl-1,8-naphthyridine-3-carboxylic acid |
| 2-methyl-5-hydroxy-1,8-naphthyridine-6-carboxylic acid |
| 7-methyl-4-oxo-1,4-dihydro-[1,8]naphthyridine-3-carboxylic acid |
| 7-Methyltetrazolo<a>chinazol-5-on |
| Tetrazolo[1,5-a]quinazolin-5(1H)-one,7-methyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid? |
| A: Related upstream materials(CAS) of 7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid: 13250-96-9. |
| Q: What is the safety information for 7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid? |
| A: Safety information for 7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid: 26-36/37. |
| Q: What is the molecular weight of 7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid? |
| A: Molecular weight of 7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid is 204.18200. |
| Q: What is the boiling point of 7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid? |
| A: Boiling point of 7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid is 396.2ºC at 760 mmHg. |
| Q: What is the English name of 7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid? |
| A: The English name of 7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid is 7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid. |
| Q: What is the melting point of 7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid? |
| A: Melting point of 7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid is 278-280 °C (decomp). |
| Q: What is the polar surface area (PSA) of 7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid? |
| A: Polar surface area (PSA) of 7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid is 83.31000. |
| Q: What is the CAS number of 7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid? |
| A: CAS number of 7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid is 13250-97-0. |
| Q: What is the LogP of 7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid? |
| A: LogP of 7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid is 1.34200. |
| Q: What is the InChIKey of 7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid? |
| A: InChIKey of 7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid is WHJTTWIMQIGVJK-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |