(2R,4S)-1-BOC-4-AMINO-PYRROLIDINE-2-CARBOXYLIC ACID
(2R,4S)-1-BOC-4-AMINO-PYRROLIDINE-2-CARBOXYLIC ACID structure
|
Common Name | (2R,4S)-1-BOC-4-AMINO-PYRROLIDINE-2-CARBOXYLIC ACID | ||
|---|---|---|---|---|
| CAS Number | 132622-78-7 | Molecular Weight | 230.26100 | |
| Density | 1.233g/cm3 | Boiling Point | 371.073ºC at 760 mmHg | |
| Molecular Formula | C10H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.219ºC | |
Use of (2R,4S)-1-BOC-4-AMINO-PYRROLIDINE-2-CARBOXYLIC ACID(4S)-1-Boc-4-amino-D-proline is an amino acid derivative that can be used for compound synthesis[1]. |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2R,4S)-4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table contains bioactivity, target information and biological‑assay experimental data of this compound.
| Description | (4S)-1-Boc-4-amino-D-proline is an amino acid derivative that can be used for compound synthesis[1]. |
|---|---|
| Related Catalog | |
| References |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.233g/cm3 |
|---|---|
| Boiling Point | 371.073ºC at 760 mmHg |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26100 |
| Flash Point | 178.219ºC |
| Exact Mass | 230.12700 |
| PSA | 92.86000 |
| LogP | 1.04590 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.517 |
| InChIKey | WDWRIVZIPSHUOR-NKWVEPMBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(N)CC1C(=O)O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
CAS#:132622-77-6
CAS#:1018332-19-8
CAS#:77450-00-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,2-Pyrrolidinedicarboxylicacid,4-amino-,1-(1,1-dimethylethyl) ester,(2R-trans)-(9CI) |
| (2R,4S)-1-BOC-4-AMINO-PYRROLIDINE-2-CARBOXYLIC ACID |
| (2R,4S)-4-Amino-1-(tert-butoxycarbonyl)pyrrolidine-2-carboxylic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (2R,4S)-4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid? |
| A: Molecular weight of (2R,4S)-4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid is 230.26100. |
| Q: What is the English name of (2R,4S)-4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid? |
| A: The English name of (2R,4S)-4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid is (2R,4S)-4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. |
| Q: What is the InChIKey of (2R,4S)-4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid? |
| A: InChIKey of (2R,4S)-4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid is WDWRIVZIPSHUOR-NKWVEPMBSA-N. |
| Q: What is the boiling point of (2R,4S)-4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid? |
| A: Boiling point of (2R,4S)-4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid is 371.073ºC at 760 mmHg. |
| Q: What is the polar surface area (PSA) of (2R,4S)-4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid? |
| A: Polar surface area (PSA) of (2R,4S)-4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid is 92.86000. |
| Q: What is the molecular formula of (2R,4S)-4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid? |
| A: Molecular formula of (2R,4S)-4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid is C10H18N2O4. |
| Q: What is the LogP of (2R,4S)-4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid? |
| A: LogP of (2R,4S)-4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid is 1.04590. |
| Q: What are the upstream materials of (2R,4S)-4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid? |
| A: Related upstream materials(CAS) of (2R,4S)-4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid: 132622-77-6;1018332-19-8;77450-00-1. |
| Q: What are the uses of (2R,4S)-4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid? |
| A: Main uses of (2R,4S)-4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid: (4S)-1-Boc-4-amino-D-proline is an amino acid derivative that can be used for compound synthesis[1]. |
| Q: What is the CAS number of (2R,4S)-4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid? |
| A: CAS number of (2R,4S)-4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid is 132622-78-7. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |