Ethyl 6-Hydroxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylate structure
|
Common Name | Ethyl 6-Hydroxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 134388-85-5 | Molecular Weight | 221.25200 | |
| Density | 1.196±0.06 g/cm3(Predicted) | Boiling Point | 377.9±42.0 °C(Predicted) | |
| Molecular Formula | C12H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl 6-Hydroxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.196±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 377.9±42.0 °C(Predicted) |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.25200 |
| Exact Mass | 221.10500 |
| PSA | 58.56000 |
| LogP | 1.29840 |
| InChIKey | GVLQCKKJTOBRSK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1Cc2cc(O)ccc2CN1 |
| Hazard Codes | Xn |
|---|
|
~%
Ethyl 6-Hydroxy... CAS#:134388-85-5 |
| Literature: Ornstein; Arnold; Augenstein; Paschal Journal of Organic Chemistry, 1991 , vol. 56, # 14 p. 4388 - 4392 |
|
~%
Ethyl 6-Hydroxy... CAS#:134388-85-5 |
| Literature: Ornstein; Arnold; Augenstein; Paschal Journal of Organic Chemistry, 1991 , vol. 56, # 14 p. 4388 - 4392 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| MFCD11505030 |