(E,E)-Piperic Acid structure
|
Common Name | (E,E)-Piperic Acid | ||
|---|---|---|---|---|
| CAS Number | 136-72-1 | Molecular Weight | 218.20500 | |
| Density | 1.34g/cm3 | Boiling Point | 427.9ºC at 760mmHg | |
| Molecular Formula | C12H10O4 | Melting Point | 216-217ºC | |
| MSDS | N/A | Flash Point | 171.4ºC | |
Summary: (E,E)-piperic acid, Chinese name: 5-(3,4-亚甲基二氧苯基)-2,4-戊二烯酸, CAS number: 136-72-1, has a molecular formula of C12H10O4 and a molecular weight of 218.20500. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (E,E)-piperic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 427.9ºC at 760mmHg |
| Melting Point | 216-217ºC |
| Molecular Formula | C12H10O4 |
| Molecular Weight | 218.20500 |
| Flash Point | 171.4ºC |
| Exact Mass | 218.05800 |
| PSA | 55.76000 |
| LogP | 2.06930 |
| InChIKey | RHBGITBPARBDPH-ZPUQHVIOSA-N |
| SMILES | O=C(O)C=CC=Cc1ccc2c(c1)OCO2 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 10 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (2E,4E)-5-(3,4-methylenedioxyphenyl)-2,4-pentadienoic acid |
| Piperinic Acid |
| (E,E)-Piperonic Acid |
| (2E,4E)-5-(1,3-Benzodioxol-5-yl)-2,4-pentadienoic Acid |
| PIPERIC ACID |
| 5-(3,4-METHYLENEDIOXYPHENYL)-2,4-PENTADIENOIC ACID |
| piperonyl pentadienoic acid |
| 5-(3',4'-methylenedioxy-phenyl)-2E,4E-pentadienoic acid |
| Piperonic Aci |
| (E,E)-Piperic Acid |
| Piperic acid (E,E)-form |
| isochavicinic acid |
| trans,trans-piperinic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (E,E)-piperic acid? |
| A: Molecular weight of (E,E)-piperic acid is 218.20500. |
| Q: What is the English name of (E,E)-piperic acid? |
| A: The English name of (E,E)-piperic acid is (E,E)-piperic acid. |
| Q: What are the downstream products of (E,E)-piperic acid? |
| A: Related downstream products(CAS) of (E,E)-piperic acid: 94-62-2;94-53-1;120-57-0;133-37-9;144-62-7;120-80-9;99-50-3;64-19-7;712-97-0;15930-53-7. |
| Q: What is the InChIKey of (E,E)-piperic acid? |
| A: InChIKey of (E,E)-piperic acid is RHBGITBPARBDPH-ZPUQHVIOSA-N. |
| Q: What is the boiling point of (E,E)-piperic acid? |
| A: Boiling point of (E,E)-piperic acid is 427.9ºC at 760mmHg. |
| Q: What is the melting point of (E,E)-piperic acid? |
| A: Melting point of (E,E)-piperic acid is 216-217ºC. |
| Q: What is the molecular formula of (E,E)-piperic acid? |
| A: Molecular formula of (E,E)-piperic acid is C12H10O4. |
| Q: What are the upstream materials of (E,E)-piperic acid? |
| A: Related upstream materials(CAS) of (E,E)-piperic acid: 94-62-2;161196-20-9;6091-43-6;98-01-1;18708-18-4;120-57-0;58005-36-0;1462-12-0;495-87-4. |
| Q: What is the polar surface area (PSA) of (E,E)-piperic acid? |
| A: Polar surface area (PSA) of (E,E)-piperic acid is 55.76000. |
| Q: What is the CAS number of (E,E)-piperic acid? |
| A: CAS number of (E,E)-piperic acid is 136-72-1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |