tetrafluoroisophthalic acid
tetrafluoroisophthalic acid structure
|
Common Name | tetrafluoroisophthalic acid | ||
|---|---|---|---|---|
| CAS Number | 1551-39-9 | Molecular Weight | 238.09300 | |
| Density | 1.812g/cm3 | Boiling Point | 351.8ºC at 760mmHg | |
| Molecular Formula | C8H2F4O4 | Melting Point | 212-214 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 166.6ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tetrafluoroisophthalic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.812g/cm3 |
|---|---|
| Boiling Point | 351.8ºC at 760mmHg |
| Melting Point | 212-214 °C(lit.) |
| Molecular Formula | C8H2F4O4 |
| Molecular Weight | 238.09300 |
| Flash Point | 166.6ºC |
| Exact Mass | 237.98900 |
| PSA | 74.60000 |
| LogP | 1.63940 |
| Vapour Pressure | 1.48E-05mmHg at 25°C |
| InChIKey | PGRIMKUYGUHAKH-UHFFFAOYSA-N |
| SMILES | O=C(O)c1c(F)c(F)c(F)c(C(=O)O)c1F |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 2917399090 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:319-82-4
CAS#:32890-92-9This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,4,5,6-tetrafluorobenzene-1,3-dicarboxylic acid |
| Tetrafluoroisophthalic acid |
| MFCD00042379 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of tetrafluoroisophthalic acid? |
| A: Molecular weight of tetrafluoroisophthalic acid is 238.09300. |
| Q: What is the molecular formula of tetrafluoroisophthalic acid? |
| A: Molecular formula of tetrafluoroisophthalic acid is C8H2F4O4. |
| Q: What English synonyms does tetrafluoroisophthalic acid have? |
| A: English synonyms of tetrafluoroisophthalic acid: 2,4,5,6-tetrafluorobenzene-1,3-dicarboxylic acid, Tetrafluoroisophthalic acid, MFCD00042379. |
| Q: What is the SMILES notation of tetrafluoroisophthalic acid? |
| A: SMILES notation of tetrafluoroisophthalic acid is O=C(O)c1c(F)c(F)c(F)c(C(=O)O)c1F. |
| Q: What is the polar surface area (PSA) of tetrafluoroisophthalic acid? |
| A: Polar surface area (PSA) of tetrafluoroisophthalic acid is 74.60000. |
| Q: What is the InChIKey of tetrafluoroisophthalic acid? |
| A: InChIKey of tetrafluoroisophthalic acid is PGRIMKUYGUHAKH-UHFFFAOYSA-N. |
| Q: What is the melting point of tetrafluoroisophthalic acid? |
| A: Melting point of tetrafluoroisophthalic acid is 212-214 °C(lit.). |
| Q: What are the upstream materials of tetrafluoroisophthalic acid? |
| A: Related upstream materials(CAS) of tetrafluoroisophthalic acid: 319-82-4. |
| Q: What is the safety information for tetrafluoroisophthalic acid? |
| A: Safety information for tetrafluoroisophthalic acid: S26-S37/39. |
| Q: What is the English name of tetrafluoroisophthalic acid? |
| A: The English name of tetrafluoroisophthalic acid is tetrafluoroisophthalic acid. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |