4-(N,N-Diethylamino)cinnamic acid
4-(N,N-Diethylamino)cinnamic acid structure
|
Common Name | 4-(N,N-Diethylamino)cinnamic acid | ||
|---|---|---|---|---|
| CAS Number | 1552-97-2 | Molecular Weight | 219.28000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-[4-(diethylamino)phenyl]prop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H17NO2 |
|---|---|
| Molecular Weight | 219.28000 |
| Exact Mass | 219.12600 |
| PSA | 40.54000 |
| LogP | 2.63060 |
| InChIKey | MNUCAAWKJBVDCA-JXMROGBWSA-N |
| SMILES | CCOC(=O)C=Cc1ccc(N(C)C)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xn |
|---|---|
| HS Code | 2922499990 |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (E)-3-[4-(dimethylamino)phenyl]-2-propenoic acid ethyl ester |
| (E)-3-(4-(DIETHYLAMINO)PHENYL)ACRYLIC ACID |
| 3-[4-(dimethylamino)phenyl]-2-propenoic acid ethyl ester |
| (E)-3-(4-dimethylammino-phenyl)acrylic acid ethyl ester |
| (2E)-3-[4-(diethylamino)phenyl]acrylic acid |
| 2-Propenoic acid,3-[4-(diethylamino)phenyl] |
| ethyl (E)-3-(N,N-dimethyl-4-aminophenyl)-2-propenoate |
| 3-(4'-dimethylaminophenyl)-(E)-propenoic acid ethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3-[4-(diethylamino)phenyl]prop-2-enoic acid? |
| A: CAS number of 3-[4-(diethylamino)phenyl]prop-2-enoic acid is 1552-97-2. |
| Q: What is the InChIKey of 3-[4-(diethylamino)phenyl]prop-2-enoic acid? |
| A: InChIKey of 3-[4-(diethylamino)phenyl]prop-2-enoic acid is MNUCAAWKJBVDCA-JXMROGBWSA-N. |
| Q: What is the polar surface area (PSA) of 3-[4-(diethylamino)phenyl]prop-2-enoic acid? |
| A: Polar surface area (PSA) of 3-[4-(diethylamino)phenyl]prop-2-enoic acid is 40.54000. |
| Q: What is the English name of 3-[4-(diethylamino)phenyl]prop-2-enoic acid? |
| A: The English name of 3-[4-(diethylamino)phenyl]prop-2-enoic acid is 3-[4-(diethylamino)phenyl]prop-2-enoic acid. |
| Q: What English synonyms does 3-[4-(diethylamino)phenyl]prop-2-enoic acid have? |
| A: English synonyms of 3-[4-(diethylamino)phenyl]prop-2-enoic acid: (E)-3-[4-(dimethylamino)phenyl]-2-propenoic acid ethyl ester, (E)-3-(4-(DIETHYLAMINO)PHENYL)ACRYLIC ACID, 3-[4-(dimethylamino)phenyl]-2-propenoic acid ethyl ester, (E)-3-(4-dimethylammino-phenyl)acrylic acid ethyl ester, (2E)-3-[4-(diethylamino)phenyl]acrylic acid, 2-Propenoic acid,3-[4-(diethylamino)phenyl], ethyl (E)-3-(N,N-dimethyl-4-aminophenyl)-2-propenoate, 3-(4'-dimethylaminophenyl)-(E)-propenoic acid ethyl ester. |
| Q: What is the molecular formula of 3-[4-(diethylamino)phenyl]prop-2-enoic acid? |
| A: Molecular formula of 3-[4-(diethylamino)phenyl]prop-2-enoic acid is C13H17NO2. |
| Q: What is the SMILES notation of 3-[4-(diethylamino)phenyl]prop-2-enoic acid? |
| A: SMILES notation of 3-[4-(diethylamino)phenyl]prop-2-enoic acid is CCOC(=O)C=Cc1ccc(N(C)C)cc1. |
| Q: What is the molecular weight of 3-[4-(diethylamino)phenyl]prop-2-enoic acid? |
| A: Molecular weight of 3-[4-(diethylamino)phenyl]prop-2-enoic acid is 219.28000. |
| Q: What is the LogP of 3-[4-(diethylamino)phenyl]prop-2-enoic acid? |
| A: LogP of 3-[4-(diethylamino)phenyl]prop-2-enoic acid is 2.63060. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |