4-Chloro-N-methyl-2-nitroaniline
4-Chloro-N-methyl-2-nitroaniline structure
|
Common Name | 4-Chloro-N-methyl-2-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 15950-17-1 | Molecular Weight | 186.596 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 317.7±27.0 °C at 760 mmHg | |
| Molecular Formula | C7H7ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146.0±23.7 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Chloro-N-methyl-2-nitroaniline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 317.7±27.0 °C at 760 mmHg |
| Molecular Formula | C7H7ClN2O2 |
| Molecular Weight | 186.596 |
| Flash Point | 146.0±23.7 °C |
| Exact Mass | 186.019608 |
| PSA | 57.85000 |
| LogP | 3.06 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.632 |
| InChIKey | LUTBHMSHJATKIS-UHFFFAOYSA-N |
| SMILES | CNc1ccc(Cl)cc1[N+](=O)[O-] |
| Storage condition | 2-8°C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-(4-chloro-2-nitrophenyl)-N-methylamine |
| 4-Chloro-N-methyl-2-nitroaniline |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4-Chloro-N-methyl-2-nitroaniline? |
| A: The English name of 4-Chloro-N-methyl-2-nitroaniline is 4-Chloro-N-methyl-2-nitroaniline. |
| Q: What is the LogP of 4-Chloro-N-methyl-2-nitroaniline? |
| A: LogP of 4-Chloro-N-methyl-2-nitroaniline is 3.06. |
| Q: What is the molecular formula of 4-Chloro-N-methyl-2-nitroaniline? |
| A: Molecular formula of 4-Chloro-N-methyl-2-nitroaniline is C7H7ClN2O2. |
| Q: What English synonyms does 4-Chloro-N-methyl-2-nitroaniline have? |
| A: English synonyms of 4-Chloro-N-methyl-2-nitroaniline: N-(4-chloro-2-nitrophenyl)-N-methylamine, 4-Chloro-N-methyl-2-nitroaniline. |
| Q: What is the SMILES notation of 4-Chloro-N-methyl-2-nitroaniline? |
| A: SMILES notation of 4-Chloro-N-methyl-2-nitroaniline is CNc1ccc(Cl)cc1[N+](=O)[O-]. |
| Q: What is the CAS number of 4-Chloro-N-methyl-2-nitroaniline? |
| A: CAS number of 4-Chloro-N-methyl-2-nitroaniline is 15950-17-1. |
| Q: What are the storage conditions for 4-Chloro-N-methyl-2-nitroaniline? |
| A: Storage conditions for 4-Chloro-N-methyl-2-nitroaniline: 2-8°C. |
| Q: What is the boiling point of 4-Chloro-N-methyl-2-nitroaniline? |
| A: Boiling point of 4-Chloro-N-methyl-2-nitroaniline is 317.7±27.0 °C at 760 mmHg. |
| Q: What is the molecular weight of 4-Chloro-N-methyl-2-nitroaniline? |
| A: Molecular weight of 4-Chloro-N-methyl-2-nitroaniline is 186.596. |
| Q: What is the InChIKey of 4-Chloro-N-methyl-2-nitroaniline? |
| A: InChIKey of 4-Chloro-N-methyl-2-nitroaniline is LUTBHMSHJATKIS-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |