dmad
dmad structure
|
Common Name | dmad | ||
|---|---|---|---|---|
| CAS Number | 16882-08-9 | Molecular Weight | 294.30100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | bis(4-(methoxycarbonyl)phenyl)acetylene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H14O4 |
|---|---|
| Molecular Weight | 294.30100 |
| Exact Mass | 294.08900 |
| PSA | 52.60000 |
| LogP | 2.65960 |
| InChIKey | HVBNYTAAHLESOR-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(C#Cc2ccc(C(=O)OC)cc2)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xn |
|---|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4,4'-(1,2-ethynediyl)bis(benzoic acid) dimethyl ester |
| dimethyl 4,4'-diphenylacetylenedicarboxylate |
| 1,2-bis(4-methoxycarbonylphenyl)acetylene |
| di(p-carbomethoxyphenyl)acetylene |
| DMAD |
| 1,4-bis(p-carbomethoxybenzene)-1,2-acetylene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of bis(4-(methoxycarbonyl)phenyl)acetylene? |
| A: CAS number of bis(4-(methoxycarbonyl)phenyl)acetylene is 16882-08-9. |
| Q: What is the InChIKey of bis(4-(methoxycarbonyl)phenyl)acetylene? |
| A: InChIKey of bis(4-(methoxycarbonyl)phenyl)acetylene is HVBNYTAAHLESOR-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of bis(4-(methoxycarbonyl)phenyl)acetylene? |
| A: SMILES notation of bis(4-(methoxycarbonyl)phenyl)acetylene is COC(=O)c1ccc(C#Cc2ccc(C(=O)OC)cc2)cc1. |
| Q: What is the English name of bis(4-(methoxycarbonyl)phenyl)acetylene? |
| A: The English name of bis(4-(methoxycarbonyl)phenyl)acetylene is bis(4-(methoxycarbonyl)phenyl)acetylene. |
| Q: What is the polar surface area (PSA) of bis(4-(methoxycarbonyl)phenyl)acetylene? |
| A: Polar surface area (PSA) of bis(4-(methoxycarbonyl)phenyl)acetylene is 52.60000. |
| Q: What English synonyms does bis(4-(methoxycarbonyl)phenyl)acetylene have? |
| A: English synonyms of bis(4-(methoxycarbonyl)phenyl)acetylene: 4,4'-(1,2-ethynediyl)bis(benzoic acid) dimethyl ester, dimethyl 4,4'-diphenylacetylenedicarboxylate, 1,2-bis(4-methoxycarbonylphenyl)acetylene, di(p-carbomethoxyphenyl)acetylene, DMAD, 1,4-bis(p-carbomethoxybenzene)-1,2-acetylene. |
| Q: What is the molecular weight of bis(4-(methoxycarbonyl)phenyl)acetylene? |
| A: Molecular weight of bis(4-(methoxycarbonyl)phenyl)acetylene is 294.30100. |
| Q: What is the LogP of bis(4-(methoxycarbonyl)phenyl)acetylene? |
| A: LogP of bis(4-(methoxycarbonyl)phenyl)acetylene is 2.65960. |
| Q: What is the molecular formula of bis(4-(methoxycarbonyl)phenyl)acetylene? |
| A: Molecular formula of bis(4-(methoxycarbonyl)phenyl)acetylene is C18H14O4. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |