4,5-Dichloro-2-(tetrahydro-pyran-2-yl)-2H-pyridazin-3-one
4,5-Dichloro-2-(tetrahydro-pyran-2-yl)-2H-pyridazin-3-one structure
|
Common Name | 4,5-Dichloro-2-(tetrahydro-pyran-2-yl)-2H-pyridazin-3-one | ||
|---|---|---|---|---|
| CAS Number | 173206-13-8 | Molecular Weight | 249.09400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,5-Dichloro-2-(tetrahydro-2H-pyran-2-yl)-3(2H)-pyridazinone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H10Cl2N2O2 |
|---|---|
| Molecular Weight | 249.09400 |
| Exact Mass | 248.01200 |
| PSA | 44.12000 |
| LogP | 2.24920 |
| InChIKey | OEDZWNISULPNLA-UHFFFAOYSA-N |
| SMILES | O=c1c(Cl)c(Cl)cnn1C1CCCCO1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4,5-Dichlor-1-(4-nitro-phenyl)-pyridaz-6-on |
| 4,5-dichloro-2-(tetrahydropyran-2-yl)-2H-pyridazin-3-one |
| 2-(4-nitrophenyl)-4,5-dichloropyridazin-3-one |
| 4,5-Dichlor-2-(4-nitro-phenyl)-pyridazin-3-on |
| 4,5-dichloro-2-(tetrahydro-2H-pyran-2-yl)pyridazin-3(2H)-one |
| 2-(tetrahydropyran-2-yl)-4,5-dichloropyridazin-3-one |
| 4,5-dichloro-2-(4-nitrophenyl)-2,3-dihydropyridazin-3-one |
| 4,5-dichloro-2-(4-nitro-phenyl)-2H-pyridazin-3-one |
| pyridazinone,2-43 |
| 2-tetrahydropyranyl-4,5-dichloropyridazin-3-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4,5-Dichloro-2-(tetrahydro-2H-pyran-2-yl)-3(2H)-pyridazinone? |
| A: The English name of 4,5-Dichloro-2-(tetrahydro-2H-pyran-2-yl)-3(2H)-pyridazinone is 4,5-Dichloro-2-(tetrahydro-2H-pyran-2-yl)-3(2H)-pyridazinone. |
| Q: What is the molecular formula of 4,5-Dichloro-2-(tetrahydro-2H-pyran-2-yl)-3(2H)-pyridazinone? |
| A: Molecular formula of 4,5-Dichloro-2-(tetrahydro-2H-pyran-2-yl)-3(2H)-pyridazinone is C9H10Cl2N2O2. |
| Q: What is the InChIKey of 4,5-Dichloro-2-(tetrahydro-2H-pyran-2-yl)-3(2H)-pyridazinone? |
| A: InChIKey of 4,5-Dichloro-2-(tetrahydro-2H-pyran-2-yl)-3(2H)-pyridazinone is OEDZWNISULPNLA-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4,5-Dichloro-2-(tetrahydro-2H-pyran-2-yl)-3(2H)-pyridazinone? |
| A: Molecular weight of 4,5-Dichloro-2-(tetrahydro-2H-pyran-2-yl)-3(2H)-pyridazinone is 249.09400. |
| Q: What is the SMILES notation of 4,5-Dichloro-2-(tetrahydro-2H-pyran-2-yl)-3(2H)-pyridazinone? |
| A: SMILES notation of 4,5-Dichloro-2-(tetrahydro-2H-pyran-2-yl)-3(2H)-pyridazinone is O=c1c(Cl)c(Cl)cnn1C1CCCCO1. |
| Q: What is the polar surface area (PSA) of 4,5-Dichloro-2-(tetrahydro-2H-pyran-2-yl)-3(2H)-pyridazinone? |
| A: Polar surface area (PSA) of 4,5-Dichloro-2-(tetrahydro-2H-pyran-2-yl)-3(2H)-pyridazinone is 44.12000. |
| Q: What is the LogP of 4,5-Dichloro-2-(tetrahydro-2H-pyran-2-yl)-3(2H)-pyridazinone? |
| A: LogP of 4,5-Dichloro-2-(tetrahydro-2H-pyran-2-yl)-3(2H)-pyridazinone is 2.24920. |
| Q: What is the CAS number of 4,5-Dichloro-2-(tetrahydro-2H-pyran-2-yl)-3(2H)-pyridazinone? |
| A: CAS number of 4,5-Dichloro-2-(tetrahydro-2H-pyran-2-yl)-3(2H)-pyridazinone is 173206-13-8. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |