1,4,7,10-tetrakis(pyridin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane
1,4,7,10-tetrakis(pyridin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane structure
|
Common Name | 1,4,7,10-tetrakis(pyridin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane | ||
|---|---|---|---|---|
| CAS Number | 185130-32-9 | Molecular Weight | 536.71400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H40N8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,4,7,10-tetrakis(pyridin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C32H40N8 |
|---|---|
| Molecular Weight | 536.71400 |
| Exact Mass | 536.33800 |
| PSA | 64.52000 |
| LogP | 3.34040 |
| InChIKey | NVFSHTYUVXEYKP-UHFFFAOYSA-N |
| SMILES | c1ccc(CN2CCN(Cc3ccccn3)CCN(Cc3ccccn3)CCN(Cc3ccccn3)CC2)nc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~20%
1,4,7,10-tetrak... CAS#:185130-32-9 |
| Literature: Wada, Atsushi; Watanabe, Masayuki; Yamanoi, Yoshinori; Nishihara, Hiroshi Chemical Communications, 2008 , # 14 p. 1671 - 1673 |
|
~89%
1,4,7,10-tetrak... CAS#:185130-32-9 |
| Literature: Natrajan, Louise S.; Khoabane, Ntai M.; Dadds, Benjamin L.; Muryn, Christopher A.; Pritchard, Robin G.; Heath, Sarah L.; Kenwright, Alan M.; Kuprov, Ilya; Faulkner, Stephen Inorganic Chemistry, 2010 , vol. 49, # 17 p. 7700 - 7709 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1,4,7,10-tetrakis(pyridin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane? |
| A: The English name of 1,4,7,10-tetrakis(pyridin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane is 1,4,7,10-tetrakis(pyridin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane. |
| Q: What is the Chinese name of 185130-32-9? |
| A: Chinese name of 185130-32-9 is 185130-32-9. |
| Q: What is the molecular formula of 1,4,7,10-tetrakis(pyridin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane? |
| A: Molecular formula of 1,4,7,10-tetrakis(pyridin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane is C32H40N8. |
| Q: What is the molecular weight of 1,4,7,10-tetrakis(pyridin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane? |
| A: Molecular weight of 1,4,7,10-tetrakis(pyridin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane is 536.71400. |
| Q: What is the LogP of 1,4,7,10-tetrakis(pyridin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane? |
| A: LogP of 1,4,7,10-tetrakis(pyridin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane is 3.34040. |
| Q: What is the SMILES notation of 1,4,7,10-tetrakis(pyridin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane? |
| A: SMILES notation of 1,4,7,10-tetrakis(pyridin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane is c1ccc(CN2CCN(Cc3ccccn3)CCN(Cc3ccccn3)CCN(Cc3ccccn3)CC2)nc1. |
| Q: What is the CAS number of 1,4,7,10-tetrakis(pyridin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane? |
| A: CAS number of 1,4,7,10-tetrakis(pyridin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane is 185130-32-9. |
| Q: What is the InChIKey of 1,4,7,10-tetrakis(pyridin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane? |
| A: InChIKey of 1,4,7,10-tetrakis(pyridin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane is NVFSHTYUVXEYKP-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 1,4,7,10-tetrakis(pyridin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane? |
| A: Polar surface area (PSA) of 1,4,7,10-tetrakis(pyridin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane is 64.52000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |