O2-benzyl O3-methyl 2-azabicyclo[2.1.1]hexane-2,3-dicarboxylate
Modify Date: 2026-07-05 19:25:37
![O2-benzyl O3-methyl 2-azabicyclo[2.1.1]hexane-2,3-dicarboxylate Structure](https://www.chemsrc.com/extcaspic/158/781663-45-4.png)
O2-benzyl O3-methyl 2-azabicyclo[2.1.1]hexane-2,3-dicarboxylate structure
|
Common Name | O2-benzyl O3-methyl 2-azabicyclo[2.1.1]hexane-2,3-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 781663-45-4 | Molecular Weight | 275.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | O2-benzyl O3-methyl 2-azabicyclo[2.1.1]hexane-2,3-dicarboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H17NO4 |
|---|---|
| Molecular Weight | 275.30 |
| InChIKey | YVLJYSCHRUPJEC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1C2CC(C2)N1C(=O)OCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of O2-benzyl O3-methyl 2-azabicyclo[2.1.1]hexane-2,3-dicarboxylate? |
| A: Molecular formula of O2-benzyl O3-methyl 2-azabicyclo[2.1.1]hexane-2,3-dicarboxylate is C15H17NO4. |
| Q: What is the InChIKey of O2-benzyl O3-methyl 2-azabicyclo[2.1.1]hexane-2,3-dicarboxylate? |
| A: InChIKey of O2-benzyl O3-methyl 2-azabicyclo[2.1.1]hexane-2,3-dicarboxylate is YVLJYSCHRUPJEC-UHFFFAOYSA-N. |
| Q: What is the English name of O2-benzyl O3-methyl 2-azabicyclo[2.1.1]hexane-2,3-dicarboxylate? |
| A: The English name of O2-benzyl O3-methyl 2-azabicyclo[2.1.1]hexane-2,3-dicarboxylate is O2-benzyl O3-methyl 2-azabicyclo[2.1.1]hexane-2,3-dicarboxylate. |
| Q: What is the molecular weight of O2-benzyl O3-methyl 2-azabicyclo[2.1.1]hexane-2,3-dicarboxylate? |
| A: Molecular weight of O2-benzyl O3-methyl 2-azabicyclo[2.1.1]hexane-2,3-dicarboxylate is 275.30. |
| Q: What is the SMILES notation of O2-benzyl O3-methyl 2-azabicyclo[2.1.1]hexane-2,3-dicarboxylate? |
| A: SMILES notation of O2-benzyl O3-methyl 2-azabicyclo[2.1.1]hexane-2,3-dicarboxylate is COC(=O)C1C2CC(C2)N1C(=O)OCc1ccccc1. |
| Q: What is the Chinese name of 781663-45-4? |
| A: Chinese name of 781663-45-4 is 781663-45-4. |
| Q: What is the CAS number of O2-benzyl O3-methyl 2-azabicyclo[2.1.1]hexane-2,3-dicarboxylate? |
| A: CAS number of O2-benzyl O3-methyl 2-azabicyclo[2.1.1]hexane-2,3-dicarboxylate is 781663-45-4. |