(R)-tert-butyl 3-formylpyrrolidine-1-carboxylate
(R)-tert-butyl 3-formylpyrrolidine-1-carboxylate structure
|
Common Name | (R)-tert-butyl 3-formylpyrrolidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 191347-94-1 | Molecular Weight | 199.247 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 276.3±33.0 °C at 760 mmHg | |
| Molecular Formula | C10H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 120.9±25.4 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (R)-3-formylpyrrolidine-1-carboxylic acid tert-butyl ester |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 276.3±33.0 °C at 760 mmHg |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.247 |
| Flash Point | 120.9±25.4 °C |
| Exact Mass | 199.120850 |
| PSA | 46.61000 |
| LogP | 0.78 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.528 |
| InChIKey | DWLADVOODHZCFV-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C=O)C1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xn |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:138108-72-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (3R)-3-FORMYL-1-PYRROLIDINECARBOXYLIC ACID TERT-BUTYL ESTER |
| (R)-tert-butyl 3-formylpyrrolidine-1-carboxylate |
| 2-Methyl-2-propanyl 3-formyl-1-pyrrolidinecarboxylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of (R)-3-formylpyrrolidine-1-carboxylic acid tert-butyl ester? |
| A: SMILES notation of (R)-3-formylpyrrolidine-1-carboxylic acid tert-butyl ester is CC(C)(C)OC(=O)N1CCC(C=O)C1. |
| Q: What is the CAS number of (R)-3-formylpyrrolidine-1-carboxylic acid tert-butyl ester? |
| A: CAS number of (R)-3-formylpyrrolidine-1-carboxylic acid tert-butyl ester is 191347-94-1. |
| Q: What is the molecular formula of (R)-3-formylpyrrolidine-1-carboxylic acid tert-butyl ester? |
| A: Molecular formula of (R)-3-formylpyrrolidine-1-carboxylic acid tert-butyl ester is C10H17NO3. |
| Q: What is the InChIKey of (R)-3-formylpyrrolidine-1-carboxylic acid tert-butyl ester? |
| A: InChIKey of (R)-3-formylpyrrolidine-1-carboxylic acid tert-butyl ester is DWLADVOODHZCFV-MRVPVSSYSA-N. |
| Q: What is the polar surface area (PSA) of (R)-3-formylpyrrolidine-1-carboxylic acid tert-butyl ester? |
| A: Polar surface area (PSA) of (R)-3-formylpyrrolidine-1-carboxylic acid tert-butyl ester is 46.61000. |
| Q: What is the English name of (R)-3-formylpyrrolidine-1-carboxylic acid tert-butyl ester? |
| A: The English name of (R)-3-formylpyrrolidine-1-carboxylic acid tert-butyl ester is (R)-3-formylpyrrolidine-1-carboxylic acid tert-butyl ester. |
| Q: What is the LogP of (R)-3-formylpyrrolidine-1-carboxylic acid tert-butyl ester? |
| A: LogP of (R)-3-formylpyrrolidine-1-carboxylic acid tert-butyl ester is 0.78. |
| Q: What English synonyms does (R)-3-formylpyrrolidine-1-carboxylic acid tert-butyl ester have? |
| A: English synonyms of (R)-3-formylpyrrolidine-1-carboxylic acid tert-butyl ester: (3R)-3-FORMYL-1-PYRROLIDINECARBOXYLIC ACID TERT-BUTYL ESTER, (R)-tert-butyl 3-formylpyrrolidine-1-carboxylate, 2-Methyl-2-propanyl 3-formyl-1-pyrrolidinecarboxylate. |
| Q: What is the molecular weight of (R)-3-formylpyrrolidine-1-carboxylic acid tert-butyl ester? |
| A: Molecular weight of (R)-3-formylpyrrolidine-1-carboxylic acid tert-butyl ester is 199.247. |
| Q: What is the boiling point of (R)-3-formylpyrrolidine-1-carboxylic acid tert-butyl ester? |
| A: Boiling point of (R)-3-formylpyrrolidine-1-carboxylic acid tert-butyl ester is 276.3±33.0 °C at 760 mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |