Fmoc-Trans-4-Fluoro-Pro-OH
Fmoc-Trans-4-Fluoro-Pro-OH structure
|
Common Name | Fmoc-Trans-4-Fluoro-Pro-OH | ||
|---|---|---|---|---|
| CAS Number | 203866-20-0 | Molecular Weight | 355.36000 | |
| Density | 1.403g/cm3 | Boiling Point | 556.024ºC at 760 mmHg | |
| Molecular Formula | C20H18FNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290.073ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(9H-fluoren-9-ylmethoxycarbonyl)-4-fluoropyrrolidine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.403g/cm3 |
|---|---|
| Boiling Point | 556.024ºC at 760 mmHg |
| Molecular Formula | C20H18FNO4 |
| Molecular Weight | 355.36000 |
| Flash Point | 290.073ºC |
| Exact Mass | 355.12200 |
| PSA | 66.84000 |
| LogP | 3.37040 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.646 |
| InChIKey | CJEQUGHYFSTTQT-XIKOKIGWSA-M |
| SMILES | O=C([O-])C1CC(F)CN1C(=O)OCC1c2ccccc2-c2ccccc21 |
| Storage condition | 2-8°C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 7 | |
|---|---|
| DownStream 0 | |
CAS#:28920-43-6
CAS#:2438-57-5
CAS#:82911-69-1
CAS#:51-35-4
CAS#:40216-83-9
CAS#:129430-93-9
CAS#:203866-14-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (2S,4R)-N-fmoc-4-fluoropyrrolidine-2-carboxylic acid |
| 4-fluoranyl-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid |
| 1-[9H-fluoren-9-ylmethoxy(oxo)methyl]-4-fluoro-2-pyrrolidinecarboxylic acid |
| (2S,4R)-4-Fluoropyrrolidine-2-carboxylic acid,N-FMOC protected |
| (2S,4R)-N-Fmoc-4-fluoroproline |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-(9H-fluoren-9-ylmethoxycarbonyl)-4-fluoropyrrolidine-2-carboxylic acid? |
| A: SMILES notation of 1-(9H-fluoren-9-ylmethoxycarbonyl)-4-fluoropyrrolidine-2-carboxylic acid is O=C([O-])C1CC(F)CN1C(=O)OCC1c2ccccc2-c2ccccc21. |
| Q: What is the molecular formula of 1-(9H-fluoren-9-ylmethoxycarbonyl)-4-fluoropyrrolidine-2-carboxylic acid? |
| A: Molecular formula of 1-(9H-fluoren-9-ylmethoxycarbonyl)-4-fluoropyrrolidine-2-carboxylic acid is C20H18FNO4. |
| Q: What English synonyms does 1-(9H-fluoren-9-ylmethoxycarbonyl)-4-fluoropyrrolidine-2-carboxylic acid have? |
| A: English synonyms of 1-(9H-fluoren-9-ylmethoxycarbonyl)-4-fluoropyrrolidine-2-carboxylic acid: (2S,4R)-N-fmoc-4-fluoropyrrolidine-2-carboxylic acid, 4-fluoranyl-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid, 1-[9H-fluoren-9-ylmethoxy(oxo)methyl]-4-fluoro-2-pyrrolidinecarboxylic acid, (2S,4R)-4-Fluoropyrrolidine-2-carboxylic acid,N-FMOC protected, (2S,4R)-N-Fmoc-4-fluoroproline. |
| Q: What is the polar surface area (PSA) of 1-(9H-fluoren-9-ylmethoxycarbonyl)-4-fluoropyrrolidine-2-carboxylic acid? |
| A: Polar surface area (PSA) of 1-(9H-fluoren-9-ylmethoxycarbonyl)-4-fluoropyrrolidine-2-carboxylic acid is 66.84000. |
| Q: What is the CAS number of 1-(9H-fluoren-9-ylmethoxycarbonyl)-4-fluoropyrrolidine-2-carboxylic acid? |
| A: CAS number of 1-(9H-fluoren-9-ylmethoxycarbonyl)-4-fluoropyrrolidine-2-carboxylic acid is 203866-20-0. |
| Q: What is the LogP of 1-(9H-fluoren-9-ylmethoxycarbonyl)-4-fluoropyrrolidine-2-carboxylic acid? |
| A: LogP of 1-(9H-fluoren-9-ylmethoxycarbonyl)-4-fluoropyrrolidine-2-carboxylic acid is 3.37040. |
| Q: What is the InChIKey of 1-(9H-fluoren-9-ylmethoxycarbonyl)-4-fluoropyrrolidine-2-carboxylic acid? |
| A: InChIKey of 1-(9H-fluoren-9-ylmethoxycarbonyl)-4-fluoropyrrolidine-2-carboxylic acid is CJEQUGHYFSTTQT-XIKOKIGWSA-M. |
| Q: What are the upstream materials of 1-(9H-fluoren-9-ylmethoxycarbonyl)-4-fluoropyrrolidine-2-carboxylic acid? |
| A: Related upstream materials(CAS) of 1-(9H-fluoren-9-ylmethoxycarbonyl)-4-fluoropyrrolidine-2-carboxylic acid: 28920-43-6;2438-57-5;82911-69-1;51-35-4;40216-83-9;129430-93-9;203866-14-2. |
| Q: What are the storage conditions for 1-(9H-fluoren-9-ylmethoxycarbonyl)-4-fluoropyrrolidine-2-carboxylic acid? |
| A: Storage conditions for 1-(9H-fluoren-9-ylmethoxycarbonyl)-4-fluoropyrrolidine-2-carboxylic acid: 2-8°C. |
| Q: What is the boiling point of 1-(9H-fluoren-9-ylmethoxycarbonyl)-4-fluoropyrrolidine-2-carboxylic acid? |
| A: Boiling point of 1-(9H-fluoren-9-ylmethoxycarbonyl)-4-fluoropyrrolidine-2-carboxylic acid is 556.024ºC at 760 mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |