boc-d-3,4,5-trifluorophenylalanine
boc-d-3,4,5-trifluorophenylalanine structure
|
Common Name | boc-d-3,4,5-trifluorophenylalanine | ||
|---|---|---|---|---|
| CAS Number | 205445-55-2 | Molecular Weight | 319.27600 | |
| Density | 1.323g/cm3 | Boiling Point | 424.4ºC at 760mmHg | |
| Molecular Formula | C14H16F3NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3,4,5-trifluorophenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.323g/cm3 |
|---|---|
| Boiling Point | 424.4ºC at 760mmHg |
| Molecular Formula | C14H16F3NO4 |
| Molecular Weight | 319.27600 |
| Flash Point | 210.5ºC |
| Exact Mass | 319.10300 |
| PSA | 75.63000 |
| LogP | 3.01520 |
| Vapour Pressure | 5.83E-08mmHg at 25°C |
| Index of Refraction | 1.495 |
| InChIKey | CWPLICWOIFEQMR-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)NC(Cc1cc(F)c(F)c(F)c1)C(=O)O |
| Storage condition | Keep Cold |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2924299090 |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (2S)-2-[(tert-Butoxycarbonyl)amino]-3-(3,4,5-trifluorophenyl)propanoic acid |
| PC0309 |
| MFCD00797559 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the storage conditions for (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3,4,5-trifluorophenyl)propanoic acid? |
| A: Storage conditions for (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3,4,5-trifluorophenyl)propanoic acid: Keep Cold. |
| Q: What is the InChIKey of (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3,4,5-trifluorophenyl)propanoic acid? |
| A: InChIKey of (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3,4,5-trifluorophenyl)propanoic acid is CWPLICWOIFEQMR-SNVBAGLBSA-N. |
| Q: What is the CAS number of (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3,4,5-trifluorophenyl)propanoic acid? |
| A: CAS number of (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3,4,5-trifluorophenyl)propanoic acid is 205445-55-2. |
| Q: What is the SMILES notation of (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3,4,5-trifluorophenyl)propanoic acid? |
| A: SMILES notation of (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3,4,5-trifluorophenyl)propanoic acid is CC(C)(C)OC(=O)NC(Cc1cc(F)c(F)c(F)c1)C(=O)O. |
| Q: What is the LogP of (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3,4,5-trifluorophenyl)propanoic acid? |
| A: LogP of (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3,4,5-trifluorophenyl)propanoic acid is 3.01520. |
| Q: What is the molecular formula of (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3,4,5-trifluorophenyl)propanoic acid? |
| A: Molecular formula of (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3,4,5-trifluorophenyl)propanoic acid is C14H16F3NO4. |
| Q: What is the boiling point of (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3,4,5-trifluorophenyl)propanoic acid? |
| A: Boiling point of (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3,4,5-trifluorophenyl)propanoic acid is 424.4ºC at 760mmHg. |
| Q: What is the molecular weight of (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3,4,5-trifluorophenyl)propanoic acid? |
| A: Molecular weight of (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3,4,5-trifluorophenyl)propanoic acid is 319.27600. |
| Q: What is the English name of (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3,4,5-trifluorophenyl)propanoic acid? |
| A: The English name of (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3,4,5-trifluorophenyl)propanoic acid is (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3,4,5-trifluorophenyl)propanoic acid. |
| Q: What is the polar surface area (PSA) of (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3,4,5-trifluorophenyl)propanoic acid? |
| A: Polar surface area (PSA) of (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3,4,5-trifluorophenyl)propanoic acid is 75.63000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |